Revision as of 07:37, 29 August 2010 editحسن علي البط (talk | contribs)Extended confirmed users, Pending changes reviewers19,940 editsm Adding category Category:Bromides (using HotCat)← Previous edit |
Latest revision as of 16:08, 11 January 2025 edit undoArthurfragoso (talk | contribs)Extended confirmed users, Template editors4,951 edits dark mode fix |
(27 intermediate revisions by 18 users not shown) |
Line 1: |
Line 1: |
|
|
{{short description|Chemical compound}} |
|
|
{{multiple issues| |
|
|
{{context|date=April 2014}} |
|
|
{{refimprove|date=July 2021}} |
|
|
}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
⚫ |
| IUPAC_name = 3-(di-2-thienylmethylene)-5-methoxy-1,1-dimethylpiperidinium bromide |
|
|
|
| verifiedrevid = 381648256 |
⚫ |
| image = TimepidiumBromide.png |
|
|
⚫ |
| IUPAC_name = 3-(di-2-thienylmethylene)-5-methoxy-1,1-dimethylpiperidinium bromide |
⚫ |
| CAS_number = 35035-05-3 |
|
|
⚫ |
| image = TimepidiumBromide.png |
|
| CAS_supplemental = |
|
|
|
| image_class = skin-invert-image |
⚫ |
| ATC_prefix = A03 |
|
|
|
|
⚫ |
| ATC_suffix = AB19 |
|
|
|
<!--Clinical data--> |
⚫ |
| ATC_supplemental = |
|
|
|
| tradename = |
⚫ |
| PubChem = 160243 |
|
|
|
| Drugs.com = {{drugs.com|international|timepidium-bromide}} |
⚫ |
| DrugBank = |
|
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
⚫ |
| chemical_formula = |
|
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
⚫ |
| C=17 | H=22 | Br=1 | N=1 | O=1 | S=2 |
|
|
⚫ |
| pregnancy_category = |
|
| molecular_weight = 400.39 g/mol |
|
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
⚫ |
| smiles = C1(CC(CC(=C(C2=CC=CS2)C3=CC=CS3)C1)OC)C. |
|
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
⚫ |
| bioavailability = |
|
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
⚫ |
| protein_bound = |
|
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
⚫ |
| metabolism = |
|
|
⚫ |
| legal_status = Rx-only |
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category= |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = Rx-only |
|
|
| routes_of_administration = SC, IM, IV |
|
| routes_of_administration = SC, IM, IV |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = 35035-05-3 |
|
⚫ |
| ATC_prefix = A03 |
|
⚫ |
| ATC_suffix = AB19 |
|
⚫ |
| ATC_supplemental = |
|
⚫ |
| PubChem = 160243 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = 8R9E4766V4 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 140841 |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| chemical_formula = |
|
⚫ |
| C=17 | H=22 | Br=1 | N=1 | O=1 | S=2 |
|
⚫ |
| smiles = C1(CC(CC(=C(C2=CC=CS2)C3=CC=CS3)C1)OC)C. |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C17H22NOS2.BrH/c1-18(2)11-13(10-14(12-18)19-3)17(15-6-4-8-20-15)16-7-5-9-21-16;/h4-9,14H,10-12H2,1-3H3;1H/q+1;/p-1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = QTSXMEPZSHLZFF-UHFFFAOYSA-M |
|
}} |
|
}} |
|
|
|
|
|
'''Timepidium bromide''' (]) is an ]. The quaternary nitrogen prevents it from crossing the ], so it is peripherally acting with no central side effects. |
|
'''Timepidium bromide''' (]) is an ]. It is used in the symptomatic treatment of visceral spasms.<ref>{{Cite web|title=Timepidium bromide: Indication, Dosage, Side Effect, Precaution {{!}} MIMS Malaysia|url=https://www.mims.com/malaysia/drug/info/timepidium%20bromide?mtype=generic|access-date=2021-07-05|website=www.mims.com}}</ref> It is also used to relieve pain associated with various gastrointestinal disorders.<ref>{{Cite web|title=Timepidium Bromide Tablets 30mg SAWAI 100 Tablets|Natural Pharmacy|url=https://www.mimaki-family-japan.com/item/detail?item_prefix=TF&item_code=005256&item_branch=001|access-date=2021-07-05|website=www.mimaki-family-japan.com}}</ref> The quaternary nitrogen prevents it from crossing the ], so it is peripherally acting with no central side effects. |
|
|
|
|
|
The same compound ''sans'' the quaternary methyl group and the methoxy ether is called ].<ref name="Shah_2018">{{cite journal | vauthors = Shah R, Verma PK | title = Therapeutic importance of synthetic thiophene | journal = Chemistry Central Journal | volume = 12 | issue = 1 | pages = 137 | date = December 2018 | pmid = 30564984 | pmc = 6768136 | doi = 10.1186/s13065-018-0511-5 | doi-access = free }}</ref> |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
{{Drugs for functional gastrointestinal disorders}} |
|
{{Drugs for functional gastrointestinal disorders}} |
|
|
{{Muscarinic acetylcholine receptor modulators}} |
⚫ |
] |
|
|
|
|
⚫ |
] |
|
|
] |
|
] |
⚫ |
] |
|
|
] |
|
|
] |
|
|
] |
|
] |
|
⚫ |
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
⚫ |
] |
|
|
] |
|
⚫ |
] |
|
|
|
|
|
|
|
|