Revision as of 13:28, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,284 edits Saving copy of the {{drugbox}} taken from revid 460639400 of page Thymopentin for the Chem/Drugbox validation project (updated: ''). |
Latest revision as of 22:45, 6 April 2023 edit Entranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers175,554 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
⚫ |
| verifiedrevid = 470609802 |
|
| Verifiedfields = changed |
|
|
⚫ |
| IUPAC_name = <small>(3''S'')-3-{{bracket|amino}}hexanoyl]amino}}-4-{{bracket|amino}}-3-methyl-1-oxobutan-2-yl]amino}}-4-oxobutanoic acid</small> |
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 410152138 |
|
⚫ |
| IUPAC_name = <small>L</small>-arginyl-<small>L</small>-lysyl-<small>L</small>-α-aspartyl-<small>L</small>-valyl-<small>L</small>-tyrosine |
|
|
| image = Thymopentin.png |
|
| image = Thymopentin.png |
|
|
|
|
Line 17: |
Line 15: |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
Line 24: |
Line 22: |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|CAS}} |
|
| CAS_number = |
|
| CAS_number = 69558-55-0 |
|
| ATC_prefix = L03 |
|
| ATC_prefix = L03 |
|
| ATC_suffix = AX09 |
|
| ATC_suffix = AX09 |
Line 36: |
Line 34: |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 397640 |
|
| ChemSpiderID = 397640 |
|
|
| NIAID_ChemDB = 000127 |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = O3Y80ZF13F |
|
| UNII = O3Y80ZF13F |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
Line 45: |
Line 44: |
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=30 | H=49 | N=9 | O=9 |
|
| C=30 | H=49 | N=9 | O=9 |
|
| molecular_weight = 679.76496 g/mol |
|
|
| smiles = O=C(N(C(=O)N(C(=O)N(C(=O)N(C(=O)O)Cc1ccc(O)cc1)C(C)C)CC(=O)O)CCCCN)(N)CCC/N=C(\N)N |
|
| smiles = O=C(N(C(=O)N(C(=O)N(C(=O)N(C(=O)O)Cc1ccc(O)cc1)C(C)C)CC(=O)O)CCCCN)(N)CCC/N=C(\N)N |
|
| InChI = 1/C30H49N9O9/c1-16(2)24(28(46)38-22(29(47)48)14-17-8-10-18(40)11-9-17)39-27(45)21(15-23(41)42)37-26(44)20(7-3-4-12-31)36-25(43)19(32)6-5-13-35-30(33)34/h8-11,16,19-22,24,40H,3-7,12-15,31-32H2,1-2H3,(H,36,43)(H,37,44)(H,38,46)(H,39,45)(H,41,42)(H,47,48)(H4,33,34,35)/t19-,20-,21-,22-,24-/m0/s1 |
|
|
| InChIKey = PSWFFKRAVBDQEG-YGQNSOCVBR |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C30H49N9O9/c1-16(2)24(28(46)38-22(29(47)48)14-17-8-10-18(40)11-9-17)39-27(45)21(15-23(41)42)37-26(44)20(7-3-4-12-31)36-25(43)19(32)6-5-13-35-30(33)34/h8-11,16,19-22,24,40H,3-7,12-15,31-32H2,1-2H3,(H,36,43)(H,37,44)(H,38,46)(H,39,45)(H,41,42)(H,47,48)(H4,33,34,35)/t19-,20-,21-,22-,24-/m0/s1 |
|
| StdInChI = 1S/C30H49N9O9/c1-16(2)24(28(46)38-22(29(47)48)14-17-8-10-18(40)11-9-17)39-27(45)21(15-23(41)42)37-26(44)20(7-3-4-12-31)36-25(43)19(32)6-5-13-35-30(33)34/h8-11,16,19-22,24,40H,3-7,12-15,31-32H2,1-2H3,(H,36,43)(H,37,44)(H,38,46)(H,39,45)(H,41,42)(H,47,48)(H4,33,34,35)/t19-,20-,21-,22-,24-/m0/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = PSWFFKRAVBDQEG-YGQNSOCVSA-N |
|
| StdInChIKey = PSWFFKRAVBDQEG-YGQNSOCVSA-N |
|
⚫ |
| synonyms = <small>L</small>-arginyl-<small>L</small>-lysyl-<small>L</small>-α-aspartyl-<small>L</small>-valyl-<small>L</small>-tyrosine |
⚫ |
| synonyms = <small>(3''S'')-3-<nowiki>amino]hexanoyl]amino]-4-<nowiki>amino]-3-methyl-1-oxobutan-2-yl]amino]-4-oxobutanoic acid</small> |
|
|
}} |
|
}} |
|
|
|
|
|
'''Thymopentin''' is an ]. As such, it has been used in several clinical studies in the early years of the ] pandemic (from 1983 to 1985). Thymopentin helped to improve immunological condition in several patients for a brief time under specific treatments.<ref name="pmid6193382">{{cite journal |vauthors=Mascart-Lemone F, Huygen K, Clumeck N, Brenez D, Bolla K, Duchateau J |title=Stimulation of cellular function by thymopentin (TP-5) in three AIDS patients |journal=Lancet |volume=322 |issue=8352 |pages=735–736 |year=1983 |pmid=6193382 |doi=10.1016/S0140-6736(83)92271-7 |s2cid=519367 |url=http://www.lancet.com/journals/lancet/article/PIIS0140-6736(83)92271-7/fulltext}}</ref><ref name="pmid6398315">{{cite journal |vauthors=Clumeck N, Van de Perre P, Mascart-Lemone F, Cran S, Bolla K, Duchateau J |title=Preliminary results on clinical and immunological effects of thymopentin in AIDS |journal=Int J Clin Pharmacol Res |volume=4 |issue= 6|pages=459–463 |year=1984 |pmid=6398315 }}</ref><ref name="pmid3898293">{{cite journal |vauthors=Clumeck N, Cran S, Van de Perre P, Mascart-Lemone F, Duchateau J, Bolla K |title=Thymopentin treatment in AIDS and pre-AIDS patients |journal=Surv Immunol Res |volume=4 |issue=1 |pages=supp1 58–62 |year=1985 |pmid=3898293 |url=https://link.springer.com/article/10.1007%2FBF02919057 |doi=10.1007/BF02919057|s2cid=36555170 }}</ref> |
|
|
|
|
|
It interacts with ]s.<ref name="pmid18159232">{{cite journal |vauthors=Liu Z, Zheng X, Wang J, Wang E |editor1-last=Egli |editor1-first=Martin |title=Molecular analysis of thymopentin binding to HLA-DR molecules |journal=PLOS ONE |volume=2 |issue=12 |pages=e1348 |year=2007 |pmid=18159232 |pmc=2137936 |doi=10.1371/journal.pone.0001348 |bibcode=2007PLoSO...2.1348L |doi-access=free }} {{open access}}</ref> |
|
|
|
|
|
It is a ] ].<ref name="pmid18692582">{{cite journal |vauthors=Peng Y, Chen Z, Yu W, etal |title=Effects of thymic polypeptides on the thymopoiesis of mouse embryonic stem cells |journal=Cell Biology International |volume= 32|issue= 10|pages= 1265–71|date=July 2008 |pmid=18692582 |doi=10.1016/j.cellbi.2008.07.011 |s2cid=24144448 }}</ref> |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
{{Immunostimulants}} |
|
|
|
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{antineoplastic-drug-stub}} |