| Revision as of 13:26, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,289 edits Saving copy of the {{chembox}} taken from revid 464867734 of page Thymidine_monophosphate for the Chem/Drugbox validation project (updated: 'ChEMBL', 'StdInChI', 'StdInChIKey'). |
Latest revision as of 02:08, 22 August 2023 edit 132.183.13.29 (talk)No edit summary |
| Line 1: |
Line 1: |
|
|
{{Technical|date=April 2022}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Chembox |
|
{{Chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 458445586 |
|
| verifiedrevid = 470609635 |
|
| ImageFile = DTMP_chemical_structure.png |
|
| ImageFile = DTMP_chemical_structure.svg |
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
| ImageSize = 121 |
|
| ImageSize = 150 |
|
| ImageName = Stereo, skeletal formula of the methyl hydrogen phosphate anion |
|
|
|
| ImageAlt = Skeletal formula of thymidine monophosphate as an anion, single negative charge |
|
|
| ImageFile1 = Deoxythymidine monophosphate anion 3D spacefill.png |
|
|
| ImageSize1 = 170 |
|
|
| ImageAlt1 = Space-filling model of the thymidine monophosphate molecule as an anion, double negative charge |
|
| IUPACName = Thymidine monophosphate |
|
| IUPACName = Thymidine monophosphate |
|
|
| OtherNames = 5'-Thymidylic acid |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
| ⚫ |
| Abbreviations = TMP |
|
|
|
| CASNo = 365-07-1 |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
|
|
|
| UNII = 43W3021X6C |
|
⚫ |
| Abbreviations = dTMP |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL = <!-- blanked - oldvalue: 394429 --> |
|
| ChEMBL = 394429 |
|
| PubChem3 = 4073694 |
|
| PubChem = 16755631 |
|
⚫ |
| ChemSpiderID = 10239189 |
|
| PubChem3_Ref = {{Pubchemcite|correct|pubchem}} |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| PubChem1 = 25791020 |
|
|
| PubChem1_Ref = {{Pubchemcite|correct|pubchem}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| PubChem1_Comment = <small>(2''R'',3''R'',5''R'')-3-hydrox,-5-pyrimidin,-2-yl</small> |
|
|
| PubChem2 = 25791703 |
|
|
| PubChem2_Ref = {{Pubchemcite|correct|pubchem}} |
|
|
| PubChem2_Comment = <small>(2''R'',3''R'',5''S'')-3-hydrox,-5-pyrimidin,-2-yl</small> |
|
|
| PubChem = 16755631 |
|
|
| PubChem_Ref = {{Pubchemcite|correct|pubchem}} |
|
|
| PubChem_Comment = <small>(2''R'',3''S'',5''R'')-3-hydrox,-5-pyrimidin,-2-yl</small> |
|
|
| PubChem4 = 16755631 |
|
|
| PubChem4_Ref = {{Pubchemcite|correct|pubchem}} |
|
|
| PubChem4_Comment = <small>(2''R'',3''S'',5''S'')-3-hydrox,-5-pyrimidin,-2-yl</small> |
|
|
| ChemSpiderID1 = 3288718 |
|
|
| ChemSpiderID1_Ref = {{chemspidercite|changed|chemspider}} |
|
| ⚫ |
| ChemSpiderID = 10239189 |
|
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID_Comment = <small>(2''R'',3''S'',5''R'')-3-hydrox,-5-pyrimidin,-2-yl</small> |
|
| ⚫ |
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 26999 |
|
| ChEBI = 26999 |
|
| Beilstein = 3916216 |
|
| Beilstein = 3916216 |
|
| SMILES = Cc1cn(C2CC(O)C(COP(=O)O2)c(:o)c1:o |
|
| SMILES = CC1=CN(C(=O)NC1=O)C2CC(C(O2)COP(=O)(O)O)O |
|
| StdInChI = 1S/C10H15N2O8P/c1-5-3-12(10(15)11-9(5)14)8-2-6(13)7(20-8)4-19-21(16,17)18/h3,6-8,13H,2,4H2,1H3,(H,11,14,15)(H2,16,17,18)/p-2/t6-,7+,8+/m0/s1 |
|
| StdInChI = 1S/C10H15N2O8P/c1-5-3-12(10(15)11-9(5)14)8-2-6(13)7(20-8)4-19-21(16,17)18/h3,6-8,13H,2,4H2,1H3,(H,11,14,15)(H2,16,17,18)/p-2 |
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
| StdInChIKey = GYOZYWVXFNDGLU-XLPZGREQSA-L |
|
| StdInChIKey = GYOZYWVXFNDGLU-UHFFFAOYSA-L |
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>10</sub>H<sub>13</sub>N<sub>2</sub>O<sub>8</sub>P<sup>2-</sup> |
|
| Formula = C<sub>10</sub>H<sub>15</sub>N<sub>2</sub>O<sub>8</sub>P |
|
| MolarMass = 320.1926 g mol<sup>-1</sup> |
|
| MolarMass = 322.2085 g mol<sup>−1</sup> |
|
| ExactMass = 320.040951914 g mol<sup>-1</sup> |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Thymidine monophosphate''' ('''TMP'''), also known as '''thymidylic acid''' (] '''thymidylate'''), '''deoxythymidine monophosphate''' ('''dTMP'''), or '''deoxythymidylic acid''' (] '''deoxythymidylate'''), is a ] that is used as a ] in ]. It is an ] of ] with the ] ]. dTMP consists of a ] ], the ] ] ], and the ] ]. Unlike the other ]s, thymidine monophosphate often does not contain the "deoxy" prefix in its name; nevertheless, its symbol often includes a "d" ("dTMP").<ref>{{cite book|title=The ACS style guide: effective communication of scientific information|year=2006|publisher=American Chemical Society|location=Washington, D.C.|isbn=978-0-8412-3999-9|edition=3rd|editor1=Coghill, Anne M.|editor2=Garson, Lorrin R.|page=|url=https://archive.org/details/acsstyleguideeff0000unse/page/244}}</ref> ''Dorland’s Illustrated Medical Dictionary''<ref name="Dorlands">{{Citation |author=Elsevier |authorlink=Elsevier |title=Dorland's Illustrated Medical Dictionary |publisher=Elsevier |url=http://dorlands.com/ |postscript=.}}</ref> provides an explanation of the nomenclature variation at its entry for thymidine. |
|
|
|
|
|
As a ], it is called by the prefix '''thymidylyl-'''. |
|
|
|
|
|
== See also == |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
|
|
|
{{Nucleobases, nucleosides, and nucleotides}} |
|
|
|
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{Biochem-stub}} |
|
|
{{Organic-chemistry-stub}} |