| Revision as of 00:09, 11 October 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'DrugBank_Ref', 'ChEBI_Ref') per [[WP:CHEMVALID|Chem...← Previous edit |
Latest revision as of 00:31, 11 March 2023 edit undoInternetArchiveBot (talk | contribs)Bots, Pending changes reviewers5,389,561 edits Rescuing 1 sources and tagging 0 as dead.) #IABot (v2.0.9.3) (Whoop whoop pull up - 12682 |
| (64 intermediate revisions by 38 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 454957076 |
|
|
|
| Watchedfields = changed |
|
| IUPAC_name = |
|
|
⚫ |
| verifiedrevid = 454958463 |
|
|
| IUPAC_name = 4-<nowiki/>{2-phenyl}piperidine |
|
| image = Tedatioxetine.svg |
|
| image = Tedatioxetine.svg |
|
|
| width = 175 |
|
|
| image2 = File:Tedatioxetine ball-and-stick model.png |
|
|
| width2 = 250 |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_status = Investigational |
|
| legal_status = Investigational |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 508233-95-2 |
|
| CAS_number = 508233-95-2 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 5H681S8O3S |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
|
| ATC_suffix = |
|
| ATC_suffix = |
|
| PubChem = |
|
| KEGG = D10170 |
|
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
| synonyms = Lu AA24530; Lu-AA-24530 |
|
| synonyms = Lu AA24530; Lu-AA-24530 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
|
| C=18 | H=21 | N=1 | S=1 |
|
| chemical_formula = C<sub>18</sub>H<sub>21</sub>NS |
|
|
⚫ |
| smiles = CC(C=C1)=CC=C1SC2=C(C3CCNCC3)C=CC=C2 |
|
| molecular_weight = 283.43 g/mol |
|
|
⚫ |
| PubChem = 9878913 |
| ⚫ |
| smiles = CC(C=C1)=CC=C1SC2=C(C3CCNCC3)C=CC=C2 |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ⚫ |
| PubChem = 9878913 |
|
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 8054590 |
|
| ChemSpiderID = 8054590 |
|
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| InChI = 1/C18H21NS/c1-14-6-8-16(9-7-14)20-18-5-3-2-4-17(18)15-10-12-19-13-11-15/h2-9,15,19H,10-13H2,1H3 |
|
|
| InChIKey = CVASBKDYSQKLSO-UHFFFAOYAT |
|
| ⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C18H21NS/c1-14-6-8-16(9-7-14)20-18-5-3-2-4-17(18)15-10-12-19-13-11-15/h2-9,15,19H,10-13H2,1H3 |
|
| StdInChI = 1S/C18H21NS/c1-14-6-8-16(9-7-14)20-18-5-3-2-4-17(18)15-10-12-19-13-11-15/h2-9,15,19H,10-13H2,1H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = CVASBKDYSQKLSO-UHFFFAOYSA-N |
|
| StdInChIKey = CVASBKDYSQKLSO-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
|
|
|
|
'''Tedatioxetine''' (developmental code name '''Lu AA24530''') is an ] ] that was discovered by scientists at ]; in 2007 Lundbeck and ] entered into a partnership that included tedatioxetine but was focused on another, more advanced Lundbeck drug candidate, ].<ref>{{cite web | vauthors = Beaulieu D | work = First Word Pharma | date = 5 September 2007 | url = http://www.firstwordpharma.com/node/88051?tsid=17#axzz3xkIEA5eH | title = Lundbeck, Takeda enter strategic alliance for mood disorder, anxiety drugs] }}</ref> |
|
'''Tedatioxetine''' is a ] currently under development by ] and ] for the treatment of ].<ref name="urlDevelopment programme - Lundbeck">{{cite web | url = http://www.lundbeck.com/investor/pipeline/development_programs/default.asp?investors | title = Development programme - Lundbeck | format = | work = | accessdate = }}</ref><ref name="urlSearch of: Lu AA24530 - List Results - ClinicalTrials.gov">{{cite web | url = http://clinicaltrials.gov/ct2/results?term=Lu+AA24530 | title = Search of: Lu AA24530 - List Results - ClinicalTrials.gov | format = | work = | accessdate = }}</ref> As of March 2010 it is in ] ]s.<ref name="urlLundbeck and Takeda finalise plans to initiate phase III pivotal clinical trials with Lu AA21004 and Lu AA24530 (March 3, 2010) | 2010 | Newsroom | Takeda Pharmaceutical Company Limited">{{cite web | url = http://www.takeda.com/press/article_35859.html | title = Lundbeck and Takeda finalise plans to initiate phase III pivotal clinical trials with Lu AA21004 and Lu AA24530 (March 3, 2010) | 2010 | Newsroom | Takeda Pharmaceutical Company Limited | format = | work = | accessdate = }}</ref> Tedatioxetine acts as a ] ] (reportedly ] according to one source), ] ], and ] ].<ref name="urlLu AA24530 shows positive results in major depressive disorder phase II study - FierceBiotech">{{cite web | url = http://www.fiercebiotech.com/press-releases/lu-aa24530-shows-positive-results-major-depressive-disorder-phase-ii-study | title = Lu AA24530 shows positive results in major depressive disorder phase II study - FierceBiotech | format = | work = | accessdate = }}</ref><ref name="urlFuture Treatments for Depression, Anxiety, Sleep Disorders, Psychosis, and ADHD -- Neurotransmitter.net">{{cite web | url = http://www.neurotransmitter.net/newdrugs.html | title = Future Treatments for Depression, Anxiety, Sleep Disorders, Psychosis, and ADHD -- Neurotransmitter.net | format = | work = | accessdate = }}</ref> An ] (NDA) is not expected to be submitted to the ] (FDA) until at least 2012.<ref name="urlDevelopment programme - Lundbeck">{{cite web | url = http://www.lundbeck.com/investor/pipeline/development_programs/default.asp?investors | title = Development programme - Lundbeck | format = | work = | accessdate = }}</ref> |
|
|
|
|
|
|
|
Tedatioxetine is reported to act as a ] (] > ] > ]) and ], ], ], and ] ].<ref name="urlUSPTO20100144788">{{cite patent | country = US | number = 2010144788 | inventor = Stensbol TB, Miller S | pubdate = 10 June 2010 | assign1 = H Lundbeck AS | title = 4- piperidine with combined serotonin and norepinephrine reuptake inhibition for the treatment of adhd, melancholia, treatment resistant depression or residual symptoms in depression }}</ref><ref name="Stahl2008">{{cite book | vauthors = Stahl SM | title = Depression and bipolar disorder: Stahl's essential psychopharmacology | url = https://books.google.com/books?id=zqvVZOea2JAC&pg=PA206 | access-date = 22 November 2011 | date = 19 May 2008 | publisher = Cambridge University Press | isbn = 978-0-521-88663-5 | pages = 206}}</ref><ref name="Stolerman2010">{{cite book | vauthors = Stolerman IP | title = Encyclopedia of Psychopharmacology | url = https://books.google.com/books?id=qoyYobgX0uwC&pg=PA105 | access-date = 22 November 2011 | date = 30 August 2010 | publisher = Springer | isbn = 978-3-540-68698-9 | pages = 105}}</ref><ref name=Fierce>{{cite web | url = http://www.fiercebiotech.com/press-releases/lu-aa24530-shows-positive-results-major-depressive-disorder-phase-ii-study | title = Lu AA24530 shows positive results in major depressive disorder phase II study | work = FierceBiotech | date = 2 July 2009 }}</ref> |
| ⚫ |
== See also == |
|
|
|
|
|
|
As of 2009, it was in ] ]s for ],<ref name=Fierce /> but there have been no updates since then, and as of August 2013 it was no longer displayed on Lundbeck's product pipeline.<ref name="urlPipeline of Lundbeck">{{cite web | url = http://investor.lundbeck.com/pipeline.cfm | title = Pipeline of Lundbeck | access-date = 25 August 2013 | archive-date = 28 September 2012 | archive-url = https://web.archive.org/web/20120928080247/http://investor.lundbeck.com/pipeline.cfm | url-status = dead }}</ref><ref>{{cite web | work = UK Medicines Information | url = http://www.ukmi.nhs.uk/applications/ndo/record_view_open.asp?newDrugID=4990 | title = Tedatioxetine | access-date = 20 January 2016 }}</ref> |
|
|
|
|
|
On May 10, 2016, all work on tedatioxetine stopped.<ref>{{Cite web| url= http://adisinsight.springer.com/drugs/800023694 |title=Tedatioxetine | work = AdisInsight | publisher = Springer Nature Switzerland AG |access-date=2016-06-09}}</ref> |
|
|
|
|
|
A Chinese patent shows that there has been interest in this compound outside of Lundbeck.<ref>{{Cite patent|country=WO|number=2015090160|title=Compound for preparing 4-(2-(4-methylphenylthio))phenylpiperidine, and preparation method and use thereof|pubdate=2015-06-25|assign=NHWA Pharma Corp.|inventor1-last=Cao |inventor1-first=Longji|inventor2-last=Xin |inventor2-first=Jianchuang|inventor3-last=Yang |inventor3-first=Xiangping}}</ref> |
|
|
|
|
⚫ |
==See also== |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
* ] |
|
* ] |
|
|
|
|
|
== References == |
|
==References== |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
|
== External links == |
|
==External links== |
|
* |
|
* |
|
|
|
|
|
|
|
|
{{Antidepressants}} |
|
{{Antidepressants}} |
|
|
{{Adrenergic receptor modulators}} |
|
{{Anxiolytics}} |
|
|
|
{{Monoamine reuptake inhibitors}} |
|
{{Serotonergics}} |
|
|
|
{{Serotonin receptor modulators}} |
|
|
|
|
|
|
] |
|
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
|
{{nervous-system-drug-stub}} |
|
{{Nervous-system-drug-stub}} |