Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Rhoifolin: Difference between pages - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
(Difference between pages)
Page 1
Page 2
Content deleted Content addedVisualWikitext
Revision as of 09:20, 20 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,289 edits Saving copy of the {{chembox}} taken from revid 456631239 of page Rhoifolin for the Chem/Drugbox validation project (updated: 'CASNo').  Latest revision as of 00:04, 7 May 2023 edit LegionMammal978 (talk | contribs)Extended confirmed users7,896 edits move systematic name 
Line 1: Line 1:
{{one source|date=September 2014}}
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{chembox
| Verifiedfields = changed | Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 425682998 | verifiedrevid = 477855186
| Name = Rhoifolin
| ImageFile = Rhoifolin.svg | Name = Rhoifolin
| ImageFile = Rhoifolin.svg
| ImageSize = 250px | ImageSize = 250px
| ImageName = Rhoifolin structure | ImageName = Rhoifolin structure
| IUPACName = 4′,5-Dihydroxy-7-flavone
| IUPACName = 7-oxy-5-hydroxy-2-(4-hydroxyphenyl)chromen-4-one | SystematicName = 7-{oxy}oxan-2-yl]oxy}-5-hydroxy-2-(4-hydroxyphenyl)-4''H''-1-benzopyran-4-one
| OtherNames = ] 7-O-] | OtherNames = ] 7-O-]
| Section1 = {{Chembox Identifiers |Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}} | CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = <!-- blanked - oldvalue: 17306-46-6 -->
| PubChem = 5282150 | CASNo = 17306-46-6
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = K86F9AKS2A
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C12627
| PubChem = 5282150
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4445347 | ChemSpiderID = 4445347
| ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 395990 | ChEMBL = 395990
| ChEBI_Ref = {{ebicite|changed|EBI}} | ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 31227 | ChEBI = 31227
| SMILES = O=C\4c5c(O)cc(O2O(CO)(O)(O)2O1O((O)(O)1O)C)cc5O/C(c3ccc(O)cc3)=C/4 | SMILES = O=C\4c5c(O)cc(O2O(CO)(O)(O)2O1O((O)(O)1O)C)cc5O/C(c3ccc(O)cc3)=C/4
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI=1S/C27H30O14/c1-10-20(32)22(34)24(36)26(37-10)41-25-23(35)21(33)18(9-28)40-27(25)38-13-6-14(30)19-15(31)8-16(39-17(19)7-13)11-2-4-12(29)5-3-11/h2-8,10,18,20-30,32-36H,9H2,1H3/t10-,18+,20-,21+,22+,23-,24+,25+,26-,27+/m0/s1 | StdInChI=1S/C27H30O14/c1-10-20(32)22(34)24(36)26(37-10)41-25-23(35)21(33)18(9-28)40-27(25)38-13-6-14(30)19-15(31)8-16(39-17(19)7-13)11-2-4-12(29)5-3-11/h2-8,10,18,20-30,32-36H,9H2,1H3/t10-,18+,20-,21+,22+,23-,24+,25+,26-,27+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = RPMNUQRUHXIGHK-PYXJVEIZSA-N | StdInChIKey = RPMNUQRUHXIGHK-PYXJVEIZSA-N
}} }}
| Section2 = {{Chembox Properties |Section2={{Chembox Properties
| Formula = C<sub>27</sub>H<sub>30</sub>O<sub>14</sub> | Formula = C<sub>27</sub>H<sub>30</sub>O<sub>14</sub>
| MolarMass = 578.52 g/mol | MolarMass = 578.52 g/mol
| Density =
| ExactMass = 578.163556 u
| Density = | MeltingPt =
| MeltingPt = | BoilingPt =
| BoilingPt =
}} }}
}} }}
'''Rhoifolin''' is a chemical compound. It is first isolated from plant '']''. The term "Rhoi" derived from generic name of plant Rhus.<ref>{{cite journal |last1=Hattori |first1=Shizuo |last2=Matsuda |first2=Hiroaki |title=Rhoifolin, a new flavone glycoside, isolated from the leaves of Rhus succedanea |journal=Archives of Biochemistry and Biophysics |date=May 1952 |volume=37 |issue=1 |pages=85–89 |doi=10.1016/0003-9861(52)90164-1 }}</ref> It is a ], a type of flavonoid isolated from '']'', China grass or ramie (leaf), from '']'', Canton lemon (leaf), from ''Citrus x aurantium'', the bigarade or bitter orange (plant), from '']'', the grapefruit (leaf), from '']'', the ] (shoot) and from ''Sabal serratula'', the ] or sabal fruit (plant).<ref></ref>
<!-- ==]==
*
-->
==References==
{{Reflist}}

<!-- ==External links==
* -->

{{flavone}}

]


{{Aromatic-stub}}
Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Rhoifolin: Difference between pages Add topic