| Revision as of 22:40, 18 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'DrugBank_Ref', 'ChEBI_Ref') per [[WP:CHEMVALID|Chem/Dr← Previous edit |
Latest revision as of 15:51, 1 November 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,129 edits +Category:Methyl esters; +Category:Ethyl compounds using HotCat |
| (18 intermediate revisions by 15 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
| verifiedrevid = 449586221 |
|
| verifiedrevid = 451225997 |
|
| IUPAC_name = methyl (1R,2S,3S,5S)-3-(4-ethyl-3-iodophenyl)-8-azabicyclooctane-2-carboxylate |
|
| IUPAC_name = methyl (1R,2S,3S,5S)-3-(4-ethyl-3-iodophenyl)-8-azabicyclooctane-2-carboxylate |
|
| image = RTI-353_structure.png |
|
| image = RTI-353_structure.png |
| Line 9: |
Line 10: |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
| Line 15: |
Line 16: |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|CAS}} |
|
| CAS_number = |
|
| CAS_number = 198990-83-9 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = ZSB3P8YAZ9 |
|
| ATC_prefix = |
|
| ATC_prefix = |
|
| ATC_suffix = |
|
| ATC_suffix = |
| Line 25: |
Line 29: |
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=17 | H=22 | I=1 | N=1 | O=2 |
|
| C=17 | H=22 | I=1 | N=1 | O=2 |
|
| molecular_weight = 399.266 g/mol |
|
|
| smiles = CCC1=C(C=C(C=C1)2C3CC(2C(=O)OC)N3)I |
|
| smiles = CCC1=C(C=C(C=C1)2C3CC(2C(=O)OC)N3)I |
|
}} |
|
}} |
|
|
|
|
|
RTI-353 is a ] derived drug which acts as an ].<ref>Navarro HA, Xu H, Zhong D, Blough BE, Ross WP, Kuhar MJ, Carroll FI. 3beta-(4-ethyl-3-iodophenyl)nortropane-2beta-carboxylic acid methyl ester (EINT): a potent and selective radioligand for the brain serotonin transporter. Synapse. 2001 Sep 1;41(3):241-7. PMID 11418937</ref><ref></ref> |
|
'''RTI(-''4229'')-353''' is a ] derived drug which acts as an ].<ref name="pmid11418937">{{cite journal | vauthors = Navarro HA, Xu H, Zhong D, Blough BE, Ross WP, Kuhar MJ, Carroll FI | title = 3beta-(4-ethyl-3-iodophenyl)nortropane-2beta-carboxylic acid methyl ester (EINT): a potent and selective radioligand for the brain serotonin transporter | journal = Synapse | location = New York, N.Y. | volume = 41 | issue = 3 | pages = 241–7 | date = September 2001 | pmid = 11418937 | doi = 10.1002/syn.1081 | s2cid = 2323766 }}</ref> Tamagnan et al. also made some phenyltropanes with high activity and selectivity for the SERT (pM affinity).<ref name="pmid16236497">{{cite journal | vauthors = Tamagnan G, Alagille D, Fu X, Kula NS, Baldessarini RJ, Innis RB, Baldwin RM | title = Synthesis and monoamine transporter affinity of new 2beta-carbomethoxy-3beta-phenyltropanes | journal = Bioorganic & Medicinal Chemistry Letters | volume = 16 | issue = 1 | pages = 217–20 | date = January 2006 | pmid = 16236497 | doi = 10.1016/j.bmcl.2005.09.016 }}</ref> |
|
|
|
|
|
|
== See also == |
|
|
*] |
|
|
*] |
|
|
*] |
|
|
*] |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist|2}} |
|
{{Reflist|2}} |
|
|
|
|
|
|
|
{{Phenyltropanes}} |
|
{{Phenyltropanes}} |
|
|
{{Monoamine reuptake inhibitors}} |
|
{{Serotonergics}} |
|
|
|
|
| ⚫ |
] |
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
⚫ |
] |
|
|
|
|
|
] |
|
|
|
|
|
{{nervous-system-drug-stub}} |
|
{{nervous-system-drug-stub}} |