| Revision as of 13:11, 5 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,294 edits Saving copy of the {{chembox}} taken from revid 463867923 of page Pinobanksin for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 12:24, 11 January 2025 edit Arthurfragoso (talk | contribs)Extended confirmed users, Template editors4,951 edits dark mode fix |
| Line 1: |
Line 1: |
|
|
{{Refimprove|date=January 2007}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 440991966 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 464207049 |
|
| ImageFile = Pinobanksin.svg |
|
| ImageFile = Pinobanksin.svg |
|
|
| ImageClass = skin-invert-image |
|
| ImageSize = 250px |
|
| ImageSize = 250px |
|
| IUPACName = (2''S'',3''R'')-3,5,7-Trihydroxy-2-phenyl-chroman-4-one |
|
| IUPACName = (2''R'',3''R'')-3,5,7-Trihydroxyflavan-4-one |
|
| OtherNames = 3,5,7-trihydroxyflavanone, 3,5,7-trihydroxy-2-phenyl-2,3-dihydro-4''H''-chromen-4-one |
|
| SystematicName = (2''R'',3''R'')-3,5,7-Trihydroxy-2-phenyl-2,3-dihydro-4''H''-1-benzopyran-4-one |
|
|
| OtherNames = 3,5,7-trihydroxy-2-phenyl-2,3-dihydro-4''H''-chromen-4-one |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 65962 |
|
| ChemSpiderID = 65962 |
|
| InChI = 1/C15H12O5/c16-9-6-10(17)12-11(7-9)20-15(14(19)13(12)18)8-4-2-1-3-5-8/h1-7,14-17,19H/t14-,15+/m0/s1 |
|
| InChI = 1/C15H12O5/c16-9-6-10(17)12-11(7-9)20-15(14(19)13(12)18)8-4-2-1-3-5-8/h1-7,14-17,19H/t14-,15+/m0/s1 |
| Line 15: |
Line 19: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = SUYJZKRQHBQNCA-LSDHHAIUSA-N |
|
| StdInChIKey = SUYJZKRQHBQNCA-LSDHHAIUSA-N |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 548-82-3 --> |
|
|
|
| CASNo= 548-82-3 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = BK3ABR33DT |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 28103 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 608410 |
|
| ChEMBL = 608410 |
|
| PubChem= 73202 |
|
| PubChem= 73202 |
|
|
| KEGG= C09826 |
|
| SMILES = O=C2c3c(O(c1ccccc1)2O)cc(O)cc3O |
|
| SMILES = O=C2c3c(O(c1ccccc1)2O)cc(O)cc3O |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>15</sub>H<sub>12</sub>O<sub>5</sub> |
|
| Formula=C<sub>15</sub>H<sub>12</sub>O<sub>5</sub> |
|
| MolarMass= 272.25 g/mol |
|
| MolarMass= 272.25 g/mol |
|
⚫ |
| Appearance= |
|
| ExactMass = 272.068473 u |
|
|
|
| Density= 1.497 g/mL |
| ⚫ |
| Appearance= |
|
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Pinobanksin''' is an ] ] (specifically a ], a category of ]) that inhibits ] of low density ] and it has electron donor properties reducing ] radicals.{{cn|date=May 2013}} It is present in ] ].<ref>{{cite journal | doi = 10.1111/j.1365-2621.1992.tb08094.x | title = Identification of Flavonoids in Sunflower Honey | year = 1992 | last1 = Sabatier | first1 = S. | last2 = Amiot | first2 = M.J. | last3 = Tacchini | first3 = M. | last4 = Aubert | first4 = S. | journal = Journal of Food Science | volume = 57 | issue = 3 | pages = 773}}</ref> |
|
|
|
|
|
Pinobanksin is ] from ]. |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
==External links== |
|
|
*{{Commonscat-inline}} |
|
|
|
|
|
{{Flavanonols}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |