| Revision as of 20:36, 20 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[WP:CHEMVALID|Chem/Drugbox validation← Previous edit |
Latest revision as of 14:44, 17 January 2025 edit undoFswitzer4 (talk | contribs)Extended confirmed users11,004 editsm Added UNII ID |
| (20 intermediate revisions by 16 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 424674389 |
|
| verifiedrevid = 451562732 |
|
| IUPAC_name = 1-anilino-3-(3,6-dibromocarbazol-9-yl)propan-2-ol |
|
| IUPAC_name = 1-anilino-3-(3,6-dibromocarbazol-9-yl)propan-2-ol |
|
| image = P7C3_structure.png |
|
| image = P7C3_structure.png |
| Line 15: |
Line 17: |
|
| legal_US = |
|
| legal_US = |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
| Line 21: |
Line 23: |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = |
|
| metabolism = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number = |
|
| CAS_number = 301353-96-8 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 77ZWJ3QXR9 |
|
| ATC_prefix = |
|
| ATC_prefix = |
|
| ATC_suffix = |
|
| ATC_suffix = |
| Line 30: |
Line 34: |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 2113543 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 2442630 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=21 | H=18 | Br=2 | N=2 | O=1 |
|
| C=21 | H=18 | Br=2 | N=2 | O=1 |
|
| molecular_weight = 474.188 g/mol |
|
|
| smiles = c4ccccc4NCC(O)Cn2c1ccc(Br)cc1c(c3)c2ccc3Br |
|
| smiles = c4ccccc4NCC(O)Cn2c1ccc(Br)cc1c(c3)c2ccc3Br |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C21H18Br2N2O/c22-14-6-8-20-18(10-14)19-11-15(23)7-9-21(19)25(20)13-17(26)12-24-16-4-2-1-3-5-16/h1-11,17,24,26H,12-13H2 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = FZHHRERIIVOATI-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''P7C3''' is a drug related to ] (dimebon), which has ] and ] effects, and may be potentially useful for the treatment of ] and similar neurodegenerative disorders. The precise mechanism of action through which these effects are exerted remains unclear as of 2010, but the pharmacological effects of P7C3 ''in vitro'' resemble those of endogenous proneurogenic peptides such as ], and the proneurogenic activity of P7C3 was around thirty times that of dimebon when they were compared side by side. P7C3 was chosen for further animal studies on the basis of favourable ] factors, such as its high oral ] and long duration of action, but several other related compounds showed similar activity such as the more potent fluorinated analogue P7C3A20 which is up to ten times stronger again, and the methoxy analogue P7C3-OMe, for which it was determined that the (R) ] is the active form.<ref name="pmid20603013">{{cite journal |author=Pieper AA, Xie S, Capota E, Estill SJ, Zhong J, Long JM, Becker GL, Huntington P, Goldman SE, Shen CH, Capota M, Britt JK, Kotti T, Ure K, Brat DJ, Williams NS, MacMillan KS, Naidoo J, Melito L, Hsieh J, De Brabander J, Ready JM, McKnight SL |title=Discovery of a proneurogenic, neuroprotective chemical |journal=Cell |volume=142 |issue=1 |pages=39–51 |year=2010 |month=July |pmid=20603013 |doi=10.1016/j.cell.2010.06.018 |url=}}</ref> |
|
'''P7C3''' (pool 7, compound 3) is a ] related to ] (dimebon) which has ] and ] effects and may be potentially useful for the treatment of ] and similar ]s. The ] effects of P7C3 '']'' resemble those of ] ] ]s such as ] (FGF-1), and the proneurogenic activity of P7C3 was around thirty times that of ] when they were compared in mice. P7C3 was chosen for further animal studies on the basis of favorable ] factors, such as its high ] ] and long ], but several other related compounds showed similar activity such as the more potent fluorinated analogue ] which is up to ten times stronger again, and the methoxy analogue ], for which it was determined that the (''R'') ] is the active form.<ref name="pmid20603013">{{cite journal |vauthors=Pieper AA, Xie S, Capota E, Estill SJ, Zhong J, Long JM, Becker GL, Huntington P, Goldman SE, Shen CH, Capota M, Britt JK, Kotti T, Ure K, Brat DJ, Williams NS, MacMillan KS, Naidoo J, Melito L, Hsieh J, De Brabander J, Ready JM, McKnight SL |title=Discovery of a proneurogenic, neuroprotective chemical |journal=Cell |volume=142 |issue=1 |pages=39–51 |date=July 2010 |pmid=20603013 |doi=10.1016/j.cell.2010.06.018 |pmc=2930815}}</ref> |
|
|
|
|
|
]{{clear-left}} |
|
] |
|
|
|
|
|
|
The ] of the P7C3 series of compounds involves activation of ] (NAMPT), the ] ] responsible for the ] of ] into ] (NAD).<ref name="pmid25215490">{{cite journal | vauthors = Wang G, Han T, Nijhawan D, Theodoropoulos P, Naidoo J, Yadavalli S, Mirzaei H, Pieper AA, Ready JM, McKnight SL | title = P7C3 neuroprotective chemicals function by activating the rate-limiting enzyme in NAD salvage | journal = Cell | volume = 158 | issue = 6 | pages = 1324–34 | year = 2014 | pmid = 25215490 | pmc = 4163014 | doi = 10.1016/j.cell.2014.07.040 }}</ref> By activating NAMPT, the P7C3 compounds result in an increase in ] levels of NAD.<ref name="pmid25215490" /> |
| ⚫ |
==References== |
|
|
{{reflist}} |
|
|
|
|
|
|
|
{{clear left}} |
|
|
|
|
|
⚫ |
==References== |
|
{{Psychostimulants, agents used for ADHD and nootropics}} |
|
|
|
{{Reflist|2}} |
|
|
|
|
|
|
{{Tricyclics}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|