Misplaced Pages

Marein: Difference between revisions

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 12:02, 30 April 2011 editNono64 (talk | contribs)Autopatrolled, Pending changes reviewers, Rollbackers96,246 editsm chalconoids← Previous edit Latest revision as of 20:36, 4 May 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,896 edits move systematic name 
(14 intermediate revisions by 12 users not shown)
Line 1: Line 1:
{{Other uses|Sankt Marein (disambiguation){{!}}Sankt Marein}} {{Other uses|Sankt Marein (disambiguation){{!}}Sankt Marein}}
{{chembox {{chembox
| Verifiedfields = changed
| Watchedfields = changed | Watchedfields = changed
| verifiedrevid = 400531229 | verifiedrevid = 426712420
| Name = Marein | Name = Marein
| ImageFile = Marein.svg | ImageFile = Marein.svg
| ImageSize = 300px | ImageSize = 300px
| IUPACName = 4′-(β-<small>D</small>-Glucopyranosyloxy)-2′,3,3′,4-tetrahydroxychalcone
| IUPACName = <nowiki>(E)-3-(3,4-dihydroxyphenyl)-1-[2,3-dihydroxy-4-[(2S,3R,4S,5S,6R)-3,4,
5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-en-1-one | SystematicName = 2′,3,3′,4-Tetrahydroxy-4′-<nowiki/>{oxy}chalcone
| OtherNames = Okanin-4'-''O''-glucoside
</nowiki>
|Section1={{Chembox Identifiers
| OtherNames = Okanin-4'-O-glucoside<!-- <br> -->
| CASNo = 535-96-6
|Section1= {{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}}=
| CASNo = 535-96-6
| CASNo1_Ref = {{cascite|correct|CAS}}
| CASNo_Ref =
| CASNo1 = 197164-34-4
| CASOther =
| CASNo1_Comment = (non-specific)
| PubChem = 6441269
| UNII_Ref = {{fdacite|correct|FDA}}
| SMILES = C1=CC(=C(C=C1C=CC(=O)C2=C(C(=C(C=C2)OC3C(C(C(C(O3)CO)O)O)O)O)O)O)O
| UNII = CY787E65J4
| InChI =
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| MeSHName =
| ChemSpiderID = 4945457
| CASNoOther =
| PubChem = 6441269
| SMILES = C1=CC(=C(C=C1C=CC(=O)C2=C(C(=C(C=C2)OC3C(C(C(C(O3)CO)O)O)O)O)O)O)O
| InChI =
| MeSHName =
}} }}
|Section2= {{Chembox Properties |Section2={{Chembox Properties
| Formula = C<sub>21</sub>H<sub>22</sub>O<sub>11</sub> | Formula = C<sub>21</sub>H<sub>22</sub>O<sub>11</sub>
| MolarMass = 450.39 g/mol | MolarMass = 450.39 g/mol
| Appearance =
| ExactMass = 450.116212 u
| Appearance = | Density =
| Density = | MeltingPt =
| MeltingPt = | BoilingPt =
| BoilingPt = | Solubility =
| Solubility =
}} }}
}} }}
'''Marein''' is an ], a type of natural phenol<ref></ref>. It is the 4'-O-] of ]. It can be found in '']''<ref></ref>. It is an ] pigment, a kind of yellow pigment<ref></ref>. '''Marein''' is a ], a type of natural phenol.<ref></ref> It is the 4'-''O''-] of ]. It can be found in '']''.<ref></ref> It is an ], a kind of yellow pigment.<ref></ref>


==References== == References ==
{{reflist}} {{reflist}}


==External links== == External links ==
* *


{{chalconoid}} {{chalconoid}}


] ]
]



{{Natural-phenol-stub}}
{{aromatic-stub}}
Marein: Difference between revisions Add topic