Revision as of 12:02, 30 April 2011 editNono64 (talk | contribs)Autopatrolled, Pending changes reviewers, Rollbackers96,246 editsm chalconoids← Previous edit |
Latest revision as of 20:36, 4 May 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,896 edits move systematic name |
(14 intermediate revisions by 12 users not shown) |
Line 1: |
Line 1: |
|
{{Other uses|Sankt Marein (disambiguation){{!}}Sankt Marein}} |
|
{{Other uses|Sankt Marein (disambiguation){{!}}Sankt Marein}} |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 400531229 |
|
| verifiedrevid = 426712420 |
|
| Name = Marein |
|
| Name = Marein |
|
| ImageFile = Marein.svg |
|
| ImageFile = Marein.svg |
|
| ImageSize = 300px |
|
| ImageSize = 300px |
|
|
| IUPACName = 4′-(β-<small>D</small>-Glucopyranosyloxy)-2′,3,3′,4-tetrahydroxychalcone |
|
| IUPACName = <nowiki>(E)-3-(3,4-dihydroxyphenyl)-1-[2,3-dihydroxy-4-[(2S,3R,4S,5S,6R)-3,4, |
|
|
5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-en-1-one |
|
| SystematicName = 2′,3,3′,4-Tetrahydroxy-4′-<nowiki/>{oxy}chalcone |
|
⚫ |
| OtherNames = Okanin-4'-''O''-glucoside |
|
</nowiki> |
|
|
⚫ |
|Section1={{Chembox Identifiers |
⚫ |
| OtherNames = Okanin-4'-O-glucoside<!-- <br> --> |
|
|
⚫ |
| CASNo = 535-96-6 |
⚫ |
|Section1= {{Chembox Identifiers |
|
|
|
| CASNo_Ref = {{cascite|correct|??}}= |
⚫ |
| CASNo = 535-96-6 |
|
|
|
| CASNo1_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = |
|
|
|
| CASNo1 = 197164-34-4 |
|
| CASOther = |
|
|
|
| CASNo1_Comment = (non-specific) |
⚫ |
| PubChem = 6441269 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
⚫ |
| SMILES = C1=CC(=C(C=C1C=CC(=O)C2=C(C(=C(C=C2)OC3C(C(C(C(O3)CO)O)O)O)O)O)O)O |
|
|
|
| UNII = CY787E65J4 |
⚫ |
| InChI = |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
⚫ |
| MeSHName = |
|
|
|
| ChemSpiderID = 4945457 |
|
|
| CASNoOther = |
|
⚫ |
| PubChem = 6441269 |
|
⚫ |
| SMILES = C1=CC(=C(C=C1C=CC(=O)C2=C(C(=C(C=C2)OC3C(C(C(C(O3)CO)O)O)O)O)O)O)O |
|
⚫ |
| InChI = |
|
⚫ |
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>21</sub>H<sub>22</sub>O<sub>11</sub> |
|
| Formula = C<sub>21</sub>H<sub>22</sub>O<sub>11</sub> |
|
| MolarMass = 450.39 g/mol |
|
| MolarMass = 450.39 g/mol |
|
|
| Appearance = |
|
| ExactMass = 450.116212 u |
|
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Marein''' is an ], a type of natural phenol<ref></ref>. It is the 4'-O-] of ]. It can be found in '']''<ref></ref>. It is an ] pigment, a kind of yellow pigment<ref></ref>. |
|
'''Marein''' is a ], a type of natural phenol.<ref></ref> It is the 4'-''O''-] of ]. It can be found in '']''.<ref></ref> It is an ], a kind of yellow pigment.<ref></ref> |
|
|
|
|
|
==References== |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
==External links== |
|
== External links == |
|
* |
|
* |
|
|
|
|
|
{{chalconoid}} |
|
{{chalconoid}} |
|
|
|
|
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
|
{{Natural-phenol-stub}} |
|
|
|
{{aromatic-stub}} |