| Revision as of 19:16, 19 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 00:38, 27 December 2023 edit undoCitation bot (talk | contribs)Bots5,472,527 edits Removed proxy/dead URL that duplicated identifier. | Use this bot. Report bugs. | #UCB_CommandLine |
| (32 intermediate revisions by 22 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
| ⚫ |
{{drugbox | verifiedrevid = 384161867 |
|
|
|
{{Drugbox |
|
| |
|
|
|
| Verifiedfields = changed |
| ⚫ |
| IUPAC_name = 4'-{(1''S'')-1-fluoro-2--1-methylethyl}-''N''-methylbiphenyl-4-carboxamide |
|
|
|
| Watchedfields = changed |
| ⚫ |
| image = LY503430.svg |
|
|
⚫ |
| verifiedrevid = 424901917 |
|
| width = 200 |
|
|
⚫ |
| IUPAC_name = 4'-{(1''S'')-1-fluoro-2--1-methylethyl}-''N''-methylbiphenyl-4-carboxamide |
| ⚫ |
| CAS_number = 625820-83-9 |
|
|
⚫ |
| image = LY503430.svg |
| ⚫ |
| synonyms = <small>LY-503,430; (''R'')-4'--biphenyl-4-carboxylic acid methylamide</small> |
|
|
|
| width = 150px |
| ⚫ |
| ATC_prefix = |
|
|
|
|
| ⚫ |
| ATC_suffix = |
|
|
|
<!--Clinical data--> |
| ⚫ |
| PubChem = |
|
|
| DrugBank = |
|
| tradename = |
|
| C = 20 | H = 25 | F = 1 | N = 2 | O = 3 | S = 1 |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| molecular_weight = 392.49 g/mol |
|
|
⚫ |
| pregnancy_category = |
| ⚫ |
| smiles = CC(C)S(=O)(=O)NCC(F)(C)c(cc2)ccc2-c(cc1)C(=O)NC |
|
|
⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
| ⚫ |
| bioavailability = |
|
|
⚫ |
| legal_CA = <!-- Schedule I --> |
| ⚫ |
| protein_bound = |
|
|
| metabolism = |
|
| legal_UK = <!-- Class A --> |
|
⚫ |
| legal_US = Investigational New Drug |
|
| elimination_half-life = |
|
|
| excretion = |
|
| legal_status = |
|
⚫ |
| routes_of_administration = ] |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
|
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
|
<!--Pharmacokinetic data--> |
| ⚫ |
| pregnancy_category= |
|
|
⚫ |
| bioavailability = |
| ⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
⚫ |
| protein_bound = |
| ⚫ |
| legal_CA = <!-- Schedule I --> |
|
|
|
| metabolism = |
|
| legal_UK = <!-- Class A --> |
|
|
|
| excretion = |
|
| legal_US = |
|
|
|
|
| ⚫ |
| legal_status = Investigational New Medicine |
|
|
|
<!--Identifiers--> |
| ⚫ |
| routes_of_administration = oral |
|
|
|
| CAS_number_Ref = {{cascite|correct|CAS}} |
|
⚫ |
| CAS_number = 625820-83-9 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 3NKZ7DGF3R |
|
⚫ |
| ATC_prefix = |
|
⚫ |
| ATC_suffix = |
|
⚫ |
| PubChem = 9952446 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 8128056 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| C=20 | H=25 | F=1 | N=2 | O=3 | S=1 |
|
⚫ |
| SMILES = CC(C)S(=O)(=O)NCC(F)(C)c(cc2)ccc2-c(cc1)ccc1C(=O)NC |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C20H25FN2O3S/c1-14(2)27(25,26)23-13-20(3,21)18-11-9-16(10-12-18)15-5-7-17(8-6-15)19(24)22-4/h5-12,14,23H,13H2,1-4H3,(H,22,24)/t20-/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = MFJKNXILEXBWNQ-FQEVSTJZSA-N |
|
⚫ |
| synonyms = <small>LY-503430; (''R'')-4'--biphenyl-4-carboxylic acid methylamide</small> |
|
}} |
|
}} |
|
|
|
|
|
'''LY-503,430''' is an ] drug developed by ].<ref>{{cite journal |doi=10.1111/j.1527-3458.2005.tb00037.x |pmid=15867954 |year=2005 |last1=O'neill |first1=MJ |last2=Murray |last3=Clay |last4=Lindstrom |last5=Yang |last6=Nisenbaum |title=LY503430: pharmacology, pharmacokinetics, and effects in rodent models of Parkinson's disease |volume=11 |issue=1 |pages=77–96 |journal=CNS drug reviews |first2=TK |first3=MP |first4=T |first5=CR |first6=ES}}</ref> |
|
'''LY-503430''' is an ] ] developed by ].<ref>{{cite journal | vauthors = O'Neill MJ, Murray TK, Clay MP, Lindstrom T, Yang CR, Nisenbaum ES | title = LY503430: pharmacology, pharmacokinetics, and effects in rodent models of Parkinson's disease | journal = CNS Drug Reviews | volume = 11 | issue = 1 | pages = 77–96 | year = 2005 | pmid = 15867954 | pmc = 6741716 | doi = 10.1111/j.1527-3458.2005.tb00037.x }}</ref> |
|
|
|
|
⚫ |
LY-503430 produces both ] and ] effects, reducing brain damage caused by ] or ] and also increasing levels of the neurotrophic factor ] in the brain, particularly in the ], ], and ].<ref>{{cite journal | vauthors = Murray TK, Whalley K, Robinson CS, Ward MA, Hicks CA, Lodge D, Vandergriff JL, Baumbarger P, Siuda E, Gates M, Ogden AM, Skolnick P, Zimmerman DM, Nisenbaum ES, Bleakman D, O'Neill MJ | display-authors = 6 | title = LY503430, a novel alpha-amino-3-hydroxy-5-methylisoxazole-4-propionic acid receptor potentiator with functional, neuroprotective and neurotrophic effects in rodent models of Parkinson's disease | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 306 | issue = 2 | pages = 752–62 | date = August 2003 | pmid = 12730350 | doi = 10.1124/jpet.103.049445 | s2cid = 86751458 }}</ref><ref>{{cite journal | vauthors = Ryder JW, Falcone JF, Manro JR, Svensson KA, Merchant KM | title = Pharmacological characterization of cGMP regulation by the biarylpropylsulfonamide class of positive, allosteric modulators of alpha-amino-3-hydroxy-5-methyl-4-isoxazolepropionic acid receptors | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 319 | issue = 1 | pages = 293–8 | date = October 2006 | pmid = 16803862 | doi = 10.1124/jpet.106.105734 | s2cid = 11732324 }}</ref> It is orally active and the main application it is currently being developed for is treatment of ], although it has also been proposed to be useful in the treatment of ], ], and ].<ref>{{cite journal | vauthors = O'Neill MJ, Bleakman D, Zimmerman DM, Nisenbaum ES | title = AMPA receptor potentiators for the treatment of CNS disorders | journal = Current Drug Targets. CNS and Neurological Disorders | volume = 3 | issue = 3 | pages = 181–94 | date = June 2004 | pmid = 15180479 | doi = 10.2174/1568007043337508 }}</ref><ref>{{cite journal | vauthors = O'Neill MJ, Witkin JM | title = AMPA receptor potentiators: application for depression and Parkinson's disease | journal = Current Drug Targets | volume = 8 | issue = 5 | pages = 603–20 | date = May 2007 | pmid = 17504104 | doi = 10.2174/138945007780618517 }}</ref> |
|
|
|
|
|
|
== See also == |
| ⚫ |
LY-503,430 produces both nootropic and neuroprotective effects, reducing brain damage caused by ] or ] and also increasing levels of the neurotrophic factor ] in the brain, particularly in the ], ] and ].<ref>{{cite journal |pmid=12730350 |year=2003 |last1=Murray |first1=TK |last2=Whalley |last3=Robinson |last4=Ward |last5=Hicks |last6=Lodge |last7=Vandergriff |last8=Baumbarger |last9=Siuda |title=LY503430, a novel alpha-amino-3-hydroxy-5-methylisoxazole-4-propionic acid receptor potentiator with functional, neuroprotective and neurotrophic effects in rodent models of Parkinson's disease |volume=306 |issue=2 |pages=752–62 |doi=10.1124/jpet.103.049445 |journal=The Journal of pharmacology and experimental therapeutics |first2=K |first3=CS |first4=MA |first5=CA |first6=D |first7=JL |first8=P |first9=E}}</ref><ref>{{cite journal |pmid=16803862 |year=2006 |last1=Ryder |first1=JW |last2=Falcone |last3=Manro |last4=Svensson |last5=Merchant |title=Pharmacological characterization of cGMP regulation by the biarylpropylsulfonamide class of positive, allosteric modulators of alpha-amino-3-hydroxy-5-methyl-4-isoxazolepropionic acid receptors |volume=319 |issue=1 |pages=293–8 |doi=10.1124/jpet.106.105734 |journal=The Journal of pharmacology and experimental therapeutics |first2=JF |first3=JR |first4=KA |first5=KM}}</ref> It is orally active and the main application it is currently being developed for is treatment of ] although it has also been proposed to be useful in the treatment of ], ] and ].<ref>{{cite journal |pmid=15180479 |year=2004 |last1=O'neill |first1=MJ |last2=Bleakman |last3=Zimmerman |last4=Nisenbaum |title=AMPA receptor potentiators for the treatment of CNS disorders |volume=3 |issue=3 |pages=181–94 |journal=Current drug targets. CNS and neurological disorders |doi=10.2174/1568007043337508 |first2=D |first3=DM |first4=ES}}</ref><ref>{{cite journal |pmid=17504104 |year=2007 |last1=O'neill |first1=MJ |last2=Witkin |title=AMPA receptor potentiators: application for depression and Parkinson's disease |volume=8 |issue=5 |pages=603–20 |journal=Current drug targets |doi=10.2174/138945007780618517 |first2=JM}}</ref> |
|
|
|
* ] |
|
|
|
|
|
⚫ |
== References == |
|
|
{{Reflist|2}} |
|
|
|
|
|
|
{{Ionotropic glutamate receptor modulators}} |
| ⚫ |
==References== |
|
|
{{reflist}} |
|
|
|
|
|
|
|
] |
|
{{Psychostimulants, agents used for ADHD and nootropics}} |
|
|
{{Glutamate_receptor_ligands}} |
|
| ⚫ |
] |
|
| ⚫ |
] |
|
|
] |
|
] |
|
⚫ |
] |
|
⚫ |
] |
|
] |
|
] |
|
] |
|
] |