Misplaced Pages

Hypoglycin B: Difference between revisions

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 12:21, 22 March 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (changes to watched fields - updated 'UNII_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (report errors or [[user talk:← Previous edit Latest revision as of 21:32, 17 September 2023 edit undoKoIobok (talk | contribs)Extended confirmed users1,350 edits Added Category:Alpha-Amino acids 
(13 intermediate revisions by 12 users not shown)
Line 1: Line 1:
{{Orphan|date=February 2009}}
{{chembox {{chembox
| Watchedfields = changed | Watchedfields = changed
| verifiedrevid = 400113393 | verifiedrevid = 420135650
| Name = Hypoglycin B | Name = Hypoglycin B
| ImageFile = Hypoglycin B.PNG | ImageFile = Hypoglycin B.svg
<!-- | ImageSize = 200px --> | ImageSize = 200px
| ImageName = Hypoglycin B | ImageName = Hypoglycin B
| IUPACName = (2S)-2-amino-4-(1S)-1-carboxy-2-<br />ethyl]carbamoyl]butanoic acid | IUPACName = γ-Glutamyl-3-alanine
| SystematicName = (2''S'')-5-({(1''S'')-1-Carboxy-2-ethyl}amino)-5-oxopentanoic acid
| OtherNames = Hypoglycine B
| OtherNames = <small>L</small>-γ-Glutamyl-<small>L</small>-hypoglycin; <small>L</small>-γ-Glutamyl-3--<small>L</small>-alanine
| Section1 = {{Chembox Identifiers | Section1 = {{Chembox Identifiers
| SMILES = O=C(N(C(=O)O)C1C(=C)C1)CC(C(=O)O)N | SMILES = O=C(N(C(=O)O)C1C(=C)C1)CC(C(=O)O)N
Line 20: Line 20:
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = UYDZYCPIQSRXKU-CIUDSAMLSA-N | StdInChIKey = UYDZYCPIQSRXKU-CIUDSAMLSA-N
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 502-37-4 | CASNo = 502-37-4
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = T83F0X4NGN
| ChEBI = 6332
| KEGG = C08280
| RTECS = | RTECS =
}} }}
| Section2 = {{Chembox Properties | Section2 = {{Chembox Properties
| Formula = C<sub>12</sub>H<sub>18</sub>N<sub>2</sub>O<sub>5</sub> | C=12|H=18|N=2|O=5
| MolarMass = 270.1216 g/mol
| Appearance =
| Density = | Density =
| Solubility = | Solubility =
Line 44: Line 47:
| ExternalMSDS = | ExternalMSDS =
| MainHazards = | MainHazards =
| FlashPt = ?°C | FlashPt =
| RPhrases =
| SPhrases = }}
}} }}
}}
'''Hypoglycin B''' is a naturally occurring organic compound in the species '']''. It is particularly concentrated in the fruit of the plant especially in the seeds. Hypoglycin B is toxic if ingested and is a causative agent of ]. It is an ] and chemically related to ].

'''Hypoglycin B''' is a naturally occurring organic compound in the species '']''. It is particularly concentrated in the fruit of the plant especially in the seeds. Hypoglycin B is toxic if ingested and is one of the causative agents of ].<ref>{{cite web | url = http://emedicine.medscape.com/article/1008792-overview | title = Ackee Fruit Toxicity | date = 28 March 2022 | publisher = ]}}</ref> It is a ] of ] and ].


==References== ==References==
{{reflist}}
{{Unreferenced|date =September 2007}}
<references/>


] ]
] ]
] ]
]




Hypoglycin B: Difference between revisions Add topic