| Revision as of 15:39, 17 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,294 edits Saving copy of the {{chembox}} taken from revid 443840294 of page Glycocholic_acid for the Chem/Drugbox validation project (updated: 'ChEMBL'). |
Latest revision as of 16:06, 2 May 2023 edit LegionMammal978 (talk | contribs)Extended confirmed users7,896 edits fix another mistake |
| Line 1: |
Line 1: |
|
⚫ |
{{Chembox |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
|
| Watchedfields = changed |
| ⚫ |
{{Chembox |
|
|
| verifiedrevid = 443839170 |
|
| verifiedrevid = 461122663 |
|
| Name = Glycocholic acid |
|
| Name = Glycocholic acid |
|
| ImageFile = Glycocholic acid.png |
|
| ImageFile = Glycocholic acid.png |
|
| ImageSize = 250px |
|
| ImageSize = 250px |
|
| ImageName = Glycocholic acid |
|
| ImageName = Glycocholic acid |
|
|
| IUPACName = ''N''-(3α,7α,12α-Trihydroxy-5β-cholan-24-oyl)glycine |
|
| IUPACName = Glycocholic acid |
|
|
|
| SystematicName = {(4''R'')-4-phenanthren-1-yl]pentanamido}acetic acid |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| IUPHAR_ligand = 4544 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 411070 |
|
| ChEMBL = 411070 |
|
| PubChem = 10140 |
|
| PubChem = 10140 |
| Line 19: |
Line 22: |
|
| StdInChIKey = RFDAIACWWDREDC-FRVQLJSFSA-N |
|
| StdInChIKey = RFDAIACWWDREDC-FRVQLJSFSA-N |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 475-31-0 |
|
| CASNo = 475-31-0 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 9734 |
|
| ChemSpiderID = 9734 |
| Line 26: |
Line 29: |
|
| SMILES = C(CCC(=O)NCC(=O)O)1CC21((C32(C43(CC(C4)O)C)O)O)C |
|
| SMILES = C(CCC(=O)NCC(=O)O)1CC21((C32(C43(CC(C4)O)C)O)O)C |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=26 | H=43 | N=1 | O=6 |
|
| Formula = C<sub>26</sub>H<sub>43</sub>NO<sub>6</sub> |
|
|
|
| Density = |
|
|
|
|
|
| MeltingPtC = 130 |
|
| MolarMass = 465.631 g/mol |
|
|
| Density = |
|
| MeltingPt_notes = |
|
⚫ |
| BoilingPt = |
|
| MeltingPt = 130 °C |
|
|
|
}} |
| ⚫ |
| BoilingPt = }} |
|
|
}} |
|
}} |
|
|
|
|
|
'''Glycocholic acid''', or '''cholylglycine''', is a crystalline ] involved in the ] of ]s. It occurs as a sodium ] in the ] of ]s. It is a ] of ] with ].<ref>{{cite web | url = https://www.ncbi.nlm.nih.gov/mesh/68006000 | title = Glycocholic Acid |publisher = ]}}</ref> Its anion is called '''glycocholate'''. |
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
{{DEFAULTSORT:Glycocholic Acid}} |
|
|
|
|
|
] |
|
|
] |
|
|
|
|
|
{{steroid-stub}} |