| Revision as of 18:05, 8 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Wiki← Previous edit |
Latest revision as of 18:06, 2 September 2024 edit undoHudecEmil (talk | contribs)Extended confirmed users6,115 edits degradation |
| (18 intermediate revisions by 15 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 443716757 |
|
| verifiedrevid = 443718549 |
|
| ImageFile = EDTMP.png |
|
| ImageFile = EDTMP.png |
|
|
| PIN={Ethane-1,2-diylbis}tetrakis(phosphonic acid) |
|
|IUPACName=methylphosphonic acid |
|
|
|OtherNames=Ethylenediamine tetra(methylene phosphonic acid), EDTMP |
|
| OtherNames=Ethylenediamine tetra(methylene phosphonic acid), EDTMP |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 14301 |
|
| ChemSpiderID = 14301 |
|
| InChI = 1/C6H20N2O12P4/c9-21(10,11)3-7(4-22(12,13)14)1-2-8(5-23(15,16)17)6-24(18,19)20/h1-6H2,(H2,9,10,11)(H2,12,13,14)(H2,15,16,17)(H2,18,19,20) |
|
| InChI = 1/C6H20N2O12P4/c9-21(10,11)3-7(4-22(12,13)14)1-2-8(5-23(15,16)17)6-24(18,19)20/h1-6H2,(H2,9,10,11)(H2,12,13,14)(H2,15,16,17)(H2,18,19,20) |
| Line 15: |
Line 16: |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo= 1429-50-1 |
|
| CASNo= 1429-50-1 |
|
| PubChem = 15025 |
|
| PubChem = 15025 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = V4CP8RSX7V |
|
| UNII = V4CP8RSX7V |
|
| SMILES = O=P(O)(O)CN(CP(=O)(O)O)CCN(CP(=O)(O)O)CP(=O)(O)O |
|
| SMILES = O=P(O)(O)CN(CP(=O)(O)O)CCN(CP(=O)(O)O)CP(=O)(O)O |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>6</sub>H<sub>20</sub>N<sub>2</sub>O<sub>12</sub>P<sub>4</sub> |
|
| Formula=C<sub>6</sub>H<sub>20</sub>N<sub>2</sub>O<sub>12</sub>P<sub>4</sub> |
|
| MolarMass |
|
| MolarMass = 436.13 |
|
| Appearance= solid |
|
| Appearance= solid |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= limited |
|
| Solubility= limited |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''EDTMP''' or '''ethylenediamine tetra(methylene phosphonic acid) ''' is a ]. It has ] and anti corrosion properties. EDTMP is the phosphonate analog of ]. |
|
'''EDTMP''' or '''ethylenediamine tetra(methylene phosphonic acid) ''' is a ]. It has ] and anti corrosion properties. EDTMP is the phosphonate analog of ].<ref name=Svara>Svara, J.; Weferling, N.; Hofmann, T. "Phosphorus Compounds, Organic," In 'Ullmann's Encyclopedia of Industrial Chemistry, Wiley-VCH, Weinheim, 2008. {{doi|10.1002/14356007.a19_545.pub2}}.</ref> It is classified as a nitrogenous organic polyphosphonic acid. |
|
|
__TOC__ |
|
|
|
|
|
==Properties== |
|
==Properties and applications== |
|
|
EDTMP is normally delivered as its sodium salt, which exhibits good solubility in water. |
|
EDTMP is normally delivered as salts, due to the acid form has very limited solubility in water. It is a nitrogenous organic polyphosphonic acid. Its corrosion inhibition is 3-5 times better than that of inorganic ], has good chemical stability and thermal tolerance. It shows excellent scale inhibition ability under temperature 200 °C. It can dissociate into 8 positive-negative ions, thus can chelate with many metal ions to form polymer reticulation complex, to destroy the normal crystallization of calcium scale. EDTMP shows better antiscale effects to ] and ]. |
|
|
|
Used in ] as an anti] and ] agent, the corrosion inhibition of EDTMP is 3–5 times better than that of inorganic ]. It can degrade to ].<ref name="y558">{{cite journal | last=Klinger | first=J. | last2=Lang | first2=M. | last3=Sacher | first3=F. | last4=Brauch | first4=H.-J. | last5=Maier | first5=D. | last6=Worch | first6=E. | title=Formation of Glyphosate and AMPA During Ozonation of Waters Containing Ethylenediaminetetra(methylenephosphonic acid) | journal=Ozone: Science & Engineering | volume=20 | issue=2 | date=1998 | issn=0191-9512 | doi=10.1080/01919519808547279 | pages=99–110}}</ref> It shows excellent scale inhibition ability under temperature 200 °C. It functions by chelating with many metal ions. |
|
|
|
|
|
⚫ |
The anti-cancer drug ] is also derived from EDTMP. |
|
==Applications== |
|
|
|
|
|
* ] and cleaning agents |
|
|
|
==References== |
| ⚫ |
* ] |
|
|
|
<references /> |
|
* ] inhibitor |
|
|
* ] |
|
| ⚫ |
** in the anti-cancer drug ] |
|
|
* ] / ] retarder |
|
|
* ] agent |
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
] |
|
|
] |
|
⚫ |
] |
|
|
] |