| Revision as of 22:28, 18 September 2011 editBogBot (talk | contribs)Bots53,132 edits populated new fields in {{drugbox}} and reordered per bot approval. Report errors and suggestions to User_talk:BogBot← Previous edit |
Latest revision as of 12:44, 14 July 2024 edit undoKku (talk | contribs)Extended confirmed users115,754 editsm link benzodiazepine |
| (15 intermediate revisions by 11 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
⚫ |
| verifiedrevid = 451223995 |
|
| Verifiedfields = changed |
|
| ⚫ |
| verifiedrevid = 399960666 |
|
|
| IUPAC_name = (6-ethyl-7-methoxy-5-methylimidazopyrimidin-2-yl)-phenylmethanone |
|
| IUPAC_name = (6-ethyl-7-methoxy-5-methylimidazopyrimidin-2-yl)-phenylmethanone |
|
| image = Divaplon.png |
|
| image = Divaplon Structure.svg |
|
| width = 180 |
|
| width = 180 |
|
|
|
|
| Line 18: |
Line 18: |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 90808-12-1 |
|
| CAS_number = 90808-12-1 |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
| Line 24: |
Line 25: |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 4AOV43246G |
|
| UNII = 4AOV43246G |
|
|
| ChemSpiderID = 59234 |
|
|
| ChEMBL = 281164 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=17 | H=17 | N=3 | O=2 |
|
| C=17 | H=17 | N=3 | O=2 |
|
| molecular_weight = 295.336 |
|
|
| smiles = CCC1=C(N2C=C(N=C2N=C1OC)C(=O)C3=CC=CC=C3)C |
|
| smiles = CCC1=C(N2C=C(N=C2N=C1OC)C(=O)C3=CC=CC=C3)C |
|
|
| StdInChI = 1S/C17H17N3O2/c1-4-13-11(2)20-10-14(18-17(20)19-16(13)22-3)15(21)12-8-6-5-7-9-12/h5-10H,4H2,1-3H3 |
|
|
| StdInChIKey = NRJVHCSYLGLURI-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''Divaplon''' ('''RU-32698''') is a ], ] and ] drug from the ] family of drugs. It acts as a ] at the "benzodiazepine site" of the ] ] in the brain.<ref>{{cite journal | last1 = Feely | first1 = M | last2 = Boyland | first2 = P | last3 = Picardo | first3 = A | last4 = Cox | first4 = A | last5 = Gent | first5 = JP | title = Lack of anticonvulsant tolerance with RU 32698 and Ro 17-1812 | journal = European journal of pharmacology | volume = 164 | issue = 2 | pages = 377–80 | year = 1989 | pmid = 2759183 | doi=10.1016/0014-2999(89)90482-2}}</ref><ref>{{cite journal | last1 = Sanger | first1 = DJ | last2 = Joly | first2 = D | last3 = Perrault | first3 = G | title = Benzodiazepine (omega) receptor partial agonists and the acquisition of conditioned fear in mice | journal = Psychopharmacology | volume = 121 | issue = 1 | pages = 104–8 | year = 1995 | pmid = 8539334 }}</ref><ref>{{cite journal | last1 = Pellón | first1 = R | last2 = Ruíz | first2 = A | last3 = Lamas | first3 = E | last4 = Rodríguez | first4 = C | title = Pharmacological analysis of the effects of benzodiazepines on punished schedule-induced polydipsia in rats | journal = Behavioural pharmacology | volume = 18 | issue = 1 | pages = 81–7 | year = 2007 | pmid = 17218801 | doi = 10.1097/FBP.0b013e3280143212 }}</ref> |
|
'''Divaplon''' ('''RU-32698''') is a ], ] and ] drug from the ] family of drugs. It acts as a ] at the "] site" of the ] ] in the brain.<ref>{{cite journal | vauthors = Feely M, Boyland P, Picardo A, Cox A, Gent JP | title = Lack of anticonvulsant tolerance with RU 32698 and Ro 17-1812 | journal = European Journal of Pharmacology | volume = 164 | issue = 2 | pages = 377–80 | date = May 1989 | pmid = 2759183 | doi = 10.1016/0014-2999(89)90482-2 }}</ref><ref>{{cite journal | vauthors = Sanger DJ, Joly D, Perrault G | s2cid = 32627339 | title = Benzodiazepine (omega) receptor partial agonists and the acquisition of conditioned fear in mice | journal = Psychopharmacology | volume = 121 | issue = 1 | pages = 104–8 | date = September 1995 | pmid = 8539334 | doi = 10.1007/BF02245596 }}</ref><ref>{{cite journal | vauthors = Pellón R, Ruíz A, Lamas E, Rodríguez C | title = Pharmacological analysis of the effects of benzodiazepines on punished schedule-induced polydipsia in rats | journal = Behavioural Pharmacology | volume = 18 | issue = 1 | pages = 81–7 | date = February 2007 | pmid = 17218801 | doi = 10.1097/FBP.0b013e3280143212 | s2cid = 40188048 }}</ref> |
|
|
|
|
|
==References== |
|
== References == |
|
|
{{reflist}} |
|
<references/> |
|
|
|
|
|
|
{{Anxiolytics}} |
|
{{Anxiolytics}} |
|
|
{{GABAAR PAMs}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |