| Revision as of 14:31, 6 April 2011 editChemNerd (talk | contribs)Extended confirmed users17,568 edits added Category:Triterpenes using HotCat← Previous edit |
Latest revision as of 14:52, 4 August 2023 edit undoCertes (talk | contribs)Extended confirmed users243,575 editsm Disambiguating links to Astragalus (link changed to Astragalus (plant)) using DisamAssist. |
| (185 intermediate revisions by 99 users not shown) |
| Line 1: |
Line 1: |
|
|
{{multiple issues| |
|
|
{{disputed||date=October 2014}} |
|
|
{{third-party||date=October 2014}} |
|
|
{{more medical citations needed|date=December 2013}} |
|
|
}} |
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 419662853 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 422699025 |
|
| ImageFile = Cycloastragenol.svg |
|
| ImageFile = Cycloastragenol.svg |
|
| ImageSize = |
|
| ImageSize = |
|
| ImageAlt = |
|
| ImageAlt = |
|
|
| IUPACName = 24α,20-Epoxy-9,19-cyclo-9β-lanost-24-ene-3β,6α,16β,25-tetrol |
|
| IUPACName = |
|
|
|
| SystematicName = (1''R'',2''S'',3a''S'',3b''S'',5''S'',5a''R'',7''S'',9a''R'',10a''S'',12a''R'')-1--3a,6,6,12a-tetramethyltetradecahydro-1''H'',10''H''-cyclopentacyclopropaphenanthrene-2,5,7-triol |
|
| OtherNames = Cyclogalegigenin; Astramembrangenin |
|
| OtherNames = Cyclogalegigenin; Astramembrangenin |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 84605-18-5 |
|
|
| PubChem = 44144539 |
|
| CASNo = 78574-94-4 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES = }} |
|
|
|
| UNII = X37D9F2L0V |
| ⚫ |
| Section2 = {{Chembox Properties |
|
|
|
| PubChem = 44144539 |
| ⚫ |
| Formula = C<sub>30</sub>H<sub>50</sub>O<sub>5</sub> |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
| MolarMass = 490.72 g/mol |
|
|
|
| ChemSpiderID = 10252332 |
| ⚫ |
| Appearance = |
|
|
|
| SMILES = CC(C)(O)1CC(C)(O1)3(O)C2(C)4C(O)6(C)(C)(O)CC65C45CC23C |
| ⚫ |
| Density = |
|
|
|
| InChI = 1/C30H50O5/c1-24(2)20(33)8-11-30-16-29(30)13-12-26(5)23(28(7)10-9-21(35-28)25(3,4)34)18(32)15-27(26,6)19(29)14-17(31)22(24)30/h17-23,31-34H,8-16H2,1-7H3/t17-,18-,19-,20-,21-,22-,23-,26+,27-,28+,29-,30+/m0/s1 |
| ⚫ |
| MeltingPt = |
|
|
|
| InChIKey = WENNXORDXYGDTP-UOUCMYEWBX |
| ⚫ |
| BoilingPt = |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
| Solubility = }} |
|
|
|
| StdInChI = 1S/C30H50O5/c1-24(2)20(33)8-11-30-16-29(30)13-12-26(5)23(28(7)10-9-21(35-28)25(3,4)34)18(32)15-27(26,6)19(29)14-17(31)22(24)30/h17-23,31-34H,8-16H2,1-7H3/t17-,18-,19-,20-,21-,22-,23-,26+,27-,28+,29-,30+/m0/s1 |
| ⚫ |
| Section3 = {{Chembox Hazards |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| MainHazards = |
|
|
|
| StdInChIKey = WENNXORDXYGDTP-UOUCMYEWSA-N }} |
| ⚫ |
| FlashPt = |
|
|
⚫ |
|Section2={{Chembox Properties |
|
| Autoignition = }} |
|
|
⚫ |
| Formula = C<sub>30</sub>H<sub>50</sub>O<sub>5</sub> |
|
⚫ |
| MolarMass = 490.72 g/mol |
|
⚫ |
| Appearance = |
|
⚫ |
| Density = |
|
⚫ |
| MeltingPt = |
|
⚫ |
| BoilingPt = |
|
⚫ |
| Solubility = }} |
|
⚫ |
|Section3={{Chembox Hazards |
|
⚫ |
| MainHazards = |
|
⚫ |
| FlashPt = |
|
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
|
'''Cycloastragenol''' is a ] isolated from various legume species in the genus '']'' that is purported to have ] activation activity. A preliminary '']'' study on human ] and ] ]s found that cycloastragenol may moderately increase telomerase activity and inhibit the onset of cellular senescence.<ref name=Valenzuela2009>{{cite journal|last1=Valenzuela|first1=Hector F|last2=Fuller|first2=Thomas|last3=Edwards|first3=Jim|last4=Finger|first4=Danielle|last5=Molgora|first5=Brenda|title=Cycloastragenol extends T cell proliferation by increasing telomerase activity|journal=J Immunol|date=April 2009|volume=182|issue=1_MeetingAbstracts|page=90.30|doi=10.4049/jimmunol.182.Supp.90.30 |s2cid=90199126 |url=http://www.jimmunol.org/cgi/content/meeting_abstract/182/1_MeetingAbstracts/90.30|accessdate=19 July 2015}}</ref> |
|
'''Cycloastragenol''' is a ] found in or derived from ]<ref></ref>/]. |
|
|
|
|
|
|
|
==History== |
|
It is used as a ] (eg '''TAT2''') and seems to moderately increase ] activity and proliferative capacity of both CD4 and CD8 ]s.<ref>{{cite web |url= |
|
|
|
Cycloastragenol was patented by ] and sold to Telomerase Activation Sciences in early 2013 who are developing it as a product named TA-65.<ref>{{Cite journal| doi = 10.1038/488018a| volume = 488| issue = 7409| pages = 18| last = Borrell| first = Brendan| title = Lawsuit challenges anti-ageing claims| journal = Nature News| date = 2012-08-02| pmid = 22859181| bibcode = 2012Natur.488...18B| doi-access = free}}</ref><ref>{{cite web |title=Application to market Cycloastragenol |url=http://acnfp.food.gov.uk/assess/fullapplics/cycloastragenol |website=acnfp.food.gov.uk |publisher=UK Advisory Committee on Novel Foods and Processes |archive-url=https://web.archive.org/web/20161001141704/http://acnfp.food.gov.uk/assess/fullapplics/cycloastragenol |access-date=29 Nov 2017|archive-date=2016-10-01 }}</ref> ] of ] has done testing on the anti-] aspect of TA-65;<ref></ref>{{unreliable source?|date=October 2014}}, as well as ] in the journal '']'', finding no increase in murine median or mean lifespan but some physiological anti-aging effects without augmenting cancer incidence.<ref name="ReferenceA">{{cite journal|doi=10.1111/j.1474-9726.2011.00700.x | pmid=21426483 | pmc=3627294 | volume=10 | title=The telomerase activator TA-65 elongates short telomeres and increases health span of adult/old mice without increasing cancer incidence | journal=Aging Cell | pages=604–21 | last1 = Bernardes | last2 = de Jesus | first2 = B | last3 = Schneeberger | first3 = K | last4 = Vera | first4 = E | last5 = Tejera | first5 = A | last6 = Harley | first6 = CB | last7 = Blasco | first7 = MA | year=2011| issue=4 }}</ref> TA sciences was served with a consent order by the ] for deceptive advertising implying that TA-65 can reverse aging and repair DNA damage.<ref>{{cite web |title=FTC Approves Final Consent Order in Telomerase Activation Sciences Deceptive Advertising Case |url=https://www.ftc.gov/news-events/press-releases/2018/04/ftc-approves-final-consent-order-telomerase-activation-sciences |website=ftc.gov |date=19 April 2018 |publisher=Federal Trade Commission |access-date=28 January 2021}}</ref> |
|
http://www.jimmunol.org/cgi/content/meeting_abstract/182/1_MeetingAbstracts/90.30 |title=Cycloastragenol extends T cell proliferation by increasing telomerase activity |year=2009 }}</ref> |
|
|
|
|
|
|
|
==Potential pharmacology== |
| ⚫ |
==References== |
|
| ⚫ |
{{reflist}} |
|
|
|
|
|
|
|
Its mode of action is purported to be the activation of the human enzyme ].<ref name=Valenzuela2009/> |
|
|
|
|
|
|
Cycloastragenol intake improved health span but not lifespan in normal mice.<ref name="ReferenceA"/> |
|
{{organic-compound-stub}} |
|
|
|
|
|
|
As part of a study sponsored by RevGenetics, the cycloastragenol-based product TA-65 was tested by UCLA scientist Rita B. Effros and RevGenetics<ref></ref> scientist Hector F. Valenzuela. The small study (using T-cells taken from 6 participants) found that TA-65 activated telomerase in cultured cells in all samples, while another ''Astragalus'' extract did not.<ref>{{cite journal|last1=Valenzuela|first1=Hector F|last2=Effros|first2=Rita B|last3=Dimler|first3=Taylor|last4=Sweeney|first4=Greg|last5=Bateman|first5=RileyH|last6=Malgora|first6=Brenda|title=Functional Assessment of Pharmacological Telomerase Activators in Human T Cells|journal=Cells|date=14 January 2013|pages=57–66|doi=10.3390/cells2010057|volume=2|issue=1|pmid=24709644|pmc=3972662|doi-access=free}}<!--|accessdate=14 January 2013--></ref> The clinical significance of this work is uncertain. |
|
|
|
|
|
Toxicity testing is limited and safety for the human consumer has not been adequately demonstrated. TA-65 was shown to improve biological markers associated with human health span through the lengthening of short telomeres and rescuing of old cells, although the significance of these findings in actual life expectancy is unknown.<ref>{{cite journal|last1=Harley|first1=Calvin B|last2=Liu|first2=Weimin|last3=Blasco|first3=Maria |last4=Vera|first4=Elsa|last5=Andrews|first5=William H|last6=Briggs|first6=Laura A|last7=Raffaele|first7=Joseph M|title=A Natural Product Telomerase Activator As Part of a Health Maintenance Program|journal=Rejuvenation Research|date=1 February 2011|volume=14|issue=1|pages=45–56|doi=10.1089/rej.2010.1085|pmid=20822369|pmc=3045570}}</ref> Publications in high-impact peer-reviewed journals are lacking however, and much of the online documentation supporting its use is sponsored by its manufacturers. |
|
|
|
|
|
As disordered telomerase function is a feature of almost all cancers,<ref>{{cite journal|last1=Shay|first1=JW|last2=Wright|first2=WE|title=Telomeres and telomerase: implications for cancer and aging|journal=Radiation Research|date=1 January 2001|volume=155|issue=1 pt 2|pages=188–193|pmid=11121233|doi=10.1667/0033-7587(2001)1552.0.co;2|bibcode=2001RadR..155..188S|s2cid=10868585 }}<!--|accessdate=4 August 2013--></ref> there is an unproven, but theoretical risk of oncogene-mediated cancer promotion through the use of telomerase activators. |
|
|
|
|
⚫ |
==References== |
|
⚫ |
{{reflist}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
] |