| Revision as of 04:46, 12 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chembox validation|Chem/Drug← Previous edit |
Latest revision as of 08:03, 8 September 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,129 edits removed Category:Chloroarenes; added Category:4-Chlorophenyl compounds using HotCat |
| (17 intermediate revisions by 14 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 444387095 |
|
⚫ |
| IUPAC_name = (''RS'')-1-Benzofuran-2-yl-(4-chlorophenyl)methanol |
|
⚫ |
| image = clobenfurol.png |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = 3611-72-1 |
|
⚫ |
| ATC_prefix = C01 |
|
⚫ |
| ATC_suffix = DX15 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 2104094 |
|
⚫ |
| PubChem = 71132 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 2L2063955H |
|
| UNII = 2L2063955H |
| ⚫ |
| verifiedrevid = 437138085 |
|
| ⚫ |
| IUPAC_name = 1-Benzofuran-2-yl-(4-chlorophenyl)methanol |
|
| ⚫ |
| image = clobenfurol.png |
|
| ⚫ |
| CAS_number = 3611-72-1 |
|
| ⚫ |
| ATC_prefix = C01 |
|
| ⚫ |
| ATC_suffix = DX15 |
|
| ⚫ |
| PubChem = 71132 |
|
| ⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| ⚫ |
| DrugBank = |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D07160 |
|
| KEGG = D07160 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
| C=15|H=11|Cl=1|O=2 |
|
|
|
| ChemSpiderID = 64279 |
|
| molecular_weight = 258.70 g/mol |
|
|
|
| smiles = c1cc(Cl)ccc1C(O)C2=Cc3ccccc3O2 |
| ⚫ |
| bioavailability = |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| protein_bound = |
|
|
|
| StdInChI = 1S/C15H11ClO2/c16-12-7-5-10(6-8-12)15(17)14-9-11-3-1-2-4-13(11)18-14/h1-9,15,17H |
| ⚫ |
| metabolism = |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| elimination_half-life = |
|
|
| excretion = |
|
| StdInChIKey = KBFBRIPYVVGWRS-UHFFFAOYSA-N |
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| ⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
| ⚫ |
}} |
|
|
|
|
|
|
|
<!--Chemical data--> |
|
'''Cloridarol''' (or '''clobenfurol''') is a ]. |
|
|
⚫ |
| C=15 | H=11 | Cl=1 | O=2 |
|
⚫ |
}} |
|
|
|
|
|
|
'''Cloridarol''' (or '''clobenfurol''') is a ].<ref name="pmid934497">{{cite journal | vauthors = Mossuti E, Nigro P, Diene G, Petralito A | title = | language = Italian | journal = Minerva Medica | volume = 67 | issue = 21 | pages = 1394–7 | date = April 1976 | pmid = 934497 | doi = | url = }}</ref> |
|
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
{{Vasodilators used in cardiac diseases}} |
|
{{Vasodilators used in cardiac diseases}} |
| Line 39: |
Line 61: |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|