Misplaced Pages

Butin (molecule): Difference between revisions

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 10:02, 15 February 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,294 edits Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: ChEMBL KEGG.← Previous edit Latest revision as of 15:58, 7 April 2024 edit undoJCW-CleanerBot (talk | contribs)Bots130,996 editsm task, replaced: graphy. A → graphy ATag: AWB 
(24 intermediate revisions by 17 users not shown)
Line 1: Line 1:
{{chembox {{chembox
| Verifiedfields = changed
⚫ | verifiedrevid = 399698354
| Watchedfields = changed
⚫ | Name = Butin
⚫ | verifiedrevid = 414038409
| ImageFile = Butin.png
| ImageSize = 200px | Name = Butin
⚫ | ImageFile = Butin.png
⚫ | IUPACName = (2''S'')-2-(3,4-Dihydroxyphenyl)-7-hydroxy-2,3-dihydrochromen-4-one
| ImageSize = 200px
⚫ | OtherNames = 3',4',7-Trihydroxyflavanone; 5-Deoxyeriodictyol
| IUPACName = (2''S'')-3′,4′,7-Trihydroxyflavan-4-one
⚫ | Section1= {{Chembox Identifiers
⚫ | SystematicName = (2''S'')-2-(3,4-Dihydroxyphenyl)-7-hydroxy-4''H''-1-benzopyran-4-one
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫ | OtherNames = 5-Deoxyeriodictyol
⚫ |Section1={{Chembox Identifiers
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 83750 | ChemSpiderID = 83750
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C09614 | KEGG = C09614
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 27725
| InChI = 1/C15H12O5/c16-9-2-3-10-12(18)7-14(20-15(10)6-9)8-1-4-11(17)13(19)5-8/h1-6,14,16-17,19H,7H2/t14-/m0/s1 | InChI = 1/C15H12O5/c16-9-2-3-10-12(18)7-14(20-15(10)6-9)8-1-4-11(17)13(19)5-8/h1-6,14,16-17,19H,7H2/t14-/m0/s1
| InChIKey = MJBPUQUGJNAPAZ-AWEZNQCLBW | InChIKey = MJBPUQUGJNAPAZ-AWEZNQCLBW
| SMILES1 = O=C2c3c(O(c1ccc(O)c(O)c1)C2)cc(O)cc3 | SMILES1 = O=C2c3c(O(c1ccc(O)c(O)c1)C2)cc(O)cc3
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 451168 | ChEMBL = 451168
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
Line 18: Line 25:
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = MJBPUQUGJNAPAZ-AWEZNQCLSA-N | StdInChIKey = MJBPUQUGJNAPAZ-AWEZNQCLSA-N
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 492-14-8 | CASNo = 492-14-8
| UNII_Ref = {{fdacite|correct|FDA}}
⚫ | PubChem = 92775
| UNII = S23T8BI9DD
⚫ | SMILES = C1C(OC2=C(C1=O)C=CC(=C2)O)C3=CC(=C(C=C3)O)OC1(OC2=C(C1=O)C=CC(=C2)O)C3=CC(=C(C=C3)O)O
⚫ | PubChem = 92775
⚫ | SMILES = C1C(OC2=C(C1=O)C=CC(=C2)O)C3=CC(=C(C=C3)O)OC1(OC2=C(C1=O)C=CC(=C2)O)C3=CC(=C(C=C3)O)O
}} }}
| Section2= {{Chembox Properties |Section2={{Chembox Properties
| C=15 | H=12 | O=5
| Formula = C<sub>15</sub>H<sub>12</sub>O<sub>5</sub>
⚫ | Appearance =
| MolarMass = 272.25 g/mol
| ExactMass = 272.068473 | Density = 1.485 g/mL
| MeltingPt=
⚫ | Appearance =
| Density= | BoilingPt=
| MeltingPt= | Solubility=
| BoilingPt=
| Solubility=
}} }}
| Section3= {{Chembox Hazards |Section3={{Chembox Hazards
| MainHazards= | MainHazards=
| FlashPt= | FlashPt=
| AutoignitionPt =
| Autoignition=
}} }}
}} }}


'''Butin''' is a ], a type of flavonoid. It can be found in the seeds of '']''<ref></ref> (Asteraceae) and in the wood of '']''<ref></ref> (Fabaceae). '''Butin''' is a ], a type of flavonoid. The compound can be found in the seeds of '']''<ref>{{cite journal | pmid = 15499936 | date = 2004 | last1 = Tian | first1 = G. | last2 = Zhang | first2 = U. | last3 = Zhang | first3 = T. | last4 = Yang | first4 = F. | last5 = Ito | first5 = Y. | title = Separation of flavonoids from the seeds of Vernonia anthelmintica Willd by high-speed counter-current chromatography | journal = Journal of Chromatography A | volume = 1049 | issue = 1–2 | pages = 219–222 | doi = 10.1016/S0021-9673(04)01276-2 }}</ref> (Asteraceae) and in the wood of '']''<ref>{{cite journal | doi = 10.1016/j.jpba.2005.04.007 | title = Simultaneous determination of 10 major flavonoids in Dalbergia odorifera by high performance liquid chromatography | date = 2005 | last1 = Liu | first1 = Rong-Xia | last2 = Wang | first2 = Qiao | last3 = Guo | first3 = Hong-Zhu | last4 = Li | first4 = Li | last5 = Bi | first5 = Kai-Shun | last6 = Guo | first6 = De-An | journal = Journal of Pharmaceutical and Biomedical Analysis | volume = 39 | issue = 3–4 | pages = 469–476 | pmid = 15935596 }}</ref> (Fabaceae).


==Glycosides== ==Glycosides==
* Butin 7-''O''-β-<small>D</small>-] is found in '']''<ref></ref> (Asteraceae). * Butin 7-''O''-β-<small>D</small>-glucopyranoside is found in '']''<ref>{{Cite journal|doi=10.1007/BF00563663|title=Flavonoids of Bidens tripartita II|journal=Chemistry of Natural Compounds|volume=8|issue=4|pages=439–441|year=1972|last1=Serbin|first1=A. G|last2=Borisov|first2=M. I|last3=Chernobai|first3=V. T|s2cid=4813333}}</ref> (Asteraceae).


==References== ==References==
{{Reflist}} {{Reflist}}


{{Flavanone}} {{Flavanone}}
Line 52: Line 60:
] ]



{{Polyphenol-stub}} {{Aromatic-stub}}
Butin (molecule): Difference between revisions Add topic