| Revision as of 06:29, 31 August 2011 editBogBot (talk | contribs)Bots53,132 edits populated new fields in {{drugbox}} and reordered per bot approval. Report errors and suggestions to User_talk:BogBot← Previous edit |
Latest revision as of 01:56, 29 January 2023 edit undoOAbot (talk | contribs)Bots443,477 editsm Open access bot: doi added to citation with #oabot. |
| (21 intermediate revisions by 15 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
⚫ |
| verifiedrevid = 447613606 |
|
| Verifiedfields = changed |
|
|
⚫ |
| IUPAC_name = ''N''--''N''-propylnaphthalene-1-carboxamide |
| ⚫ |
| verifiedrevid = 399697497 |
|
| ⚫ |
| IUPAC_name = ''N''--''N''-propylnaphthalene-1-carboxamide |
|
|
| image = Bunaftine.svg |
|
| image = Bunaftine.svg |
|
|
|
|
| Line 24: |
Line 24: |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 32421-46-8 |
|
| CAS_number = 32421-46-8 |
|
| ATC_prefix = C01 |
|
| ATC_prefix = C01 |
|
| ATC_suffix = BD03 |
|
| ATC_suffix = BD03 |
|
| PubChem = 36131 |
|
| PubChem = 36131 |
|
|
| ChEMBL = 2104200 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 33233 |
|
| ChemSpiderID = 33233 |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = GH09PRQ3FU |
|
| UNII = GH09PRQ3FU |
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D07428 |
|
| KEGG = D07428 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=21 | H=30 | N=2 | O=1 |
|
| C=21 | H=30 | N=2 | O=1 |
|
| molecular_weight = 326.476 g/mol |
|
|
| smiles = O=C(N(CCCC)CCN(CC)CC)c2cccc1ccccc12 |
|
| smiles = O=C(N(CCCC)CCN(CC)CC)c2cccc1ccccc12 |
|
| InChI = 1/C21H30N2O/c1-4-7-15-23(17-16-22(5-2)6-3)21(24)20-14-10-12-18-11-8-9-13-19(18)20/h8-14H,4-7,15-17H2,1-3H3 |
|
|
| InChIKey = WWGZXRYELYWJBD-UHFFFAOYAK |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C21H30N2O/c1-4-7-15-23(17-16-22(5-2)6-3)21(24)20-14-10-12-18-11-8-9-13-19(18)20/h8-14H,4-7,15-17H2,1-3H3 |
|
| StdInChI = 1S/C21H30N2O/c1-4-7-15-23(17-16-22(5-2)6-3)21(24)20-14-10-12-18-11-8-9-13-19(18)20/h8-14H,4-7,15-17H2,1-3H3 |
| Line 48: |
Line 47: |
|
| StdInChIKey = WWGZXRYELYWJBD-UHFFFAOYSA-N |
|
| StdInChIKey = WWGZXRYELYWJBD-UHFFFAOYSA-N |
|
}} |
|
}} |
|
'''Bunaftine''' is a ].<ref name="pmid6876382">{{cite journal |author=Ferro G, Chiariello M, Tari MG, Vigorito C, Ungaro B, Condorelli M |title=Intropic effects of several antiarrhythmic drugs |journal=Jpn Heart J |volume=24 |issue=3 |pages=377–90 |year=1983 |month=May |pmid=6876382 |doi= |url=}}</ref> It is classified in class III.<ref name="pmid328029">{{cite journal |author=Fenici R, Marchei M, Bellocci F, Zecchi P |title=Effect of bunaphtine on right atrial repolarisation in man |journal=Br Heart J |volume=39 |issue=7 |pages=787–94 |year=1977 |month=July |pmid=328029 |pmc=483317 |doi= 10.1136/hrt.39.7.787|url=http://heart.bmj.com/cgi/pmidlookup?view=long&pmid=328029}}</ref> |
|
|
|
|
|
|
It is also spelled "bunaphtine".<ref name="pmid7436628">{{cite journal |author=Tamargo J |title=Electrophysiological effects of bunaphtine in guinea-pig ventricular fibers |journal=Arch Int Pharmacodyn Ther |volume=246 |issue=2 |pages=224–36 |year=1980 |month=August |pmid=7436628 |doi= |url=}}</ref> |
|
'''Bunaftine''' (or '''bunaphtine'''<ref name="pmid7436628">{{cite journal |author=Tamargo J |title=Electrophysiological effects of bunaphtine in guinea-pig ventricular fibers |journal=Arch Int Pharmacodyn Ther |volume=246 |issue=2 |pages=224–36 |date=August 1980 |pmid=7436628 }}</ref>) is an ].<ref name="pmid6876382">{{cite journal |vauthors=Ferro G, Chiariello M, Tari MG, Vigorito C, Ungaro B, Condorelli M |title=Intropic effects of several antiarrhythmic drugs |journal=Jpn Heart J |volume=24 |issue=3 |pages=377–90 |date=May 1983 |pmid=6876382 |doi= 10.1536/ihj.24.377|doi-access=free }}</ref> It is classified in ].<ref name="pmid328029">{{cite journal |vauthors=Fenici R, Marchei M, Bellocci F, Zecchi P |title=Effect of bunaphtine on right atrial repolarisation in man |journal=Br Heart J |volume=39 |issue=7 |pages=787–94 |date=July 1977 |pmid=328029 |pmc=483317 |doi= 10.1136/hrt.39.7.787|url=}}</ref> |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
{{Potassium channel blockers}} |
|
{{Potassium channel blockers}} |
|
{{Antiarrhythmic agents}} |
|
{{Antiarrhythmic agents}} |
| Line 59: |
Line 58: |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
|
{{cardiovascular-drug-stub}} |
|
{{cardiovascular-drug-stub}} |
|
|
|
|
] |
|
|
] |
|