| Revision as of 14:18, 17 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,294 edits Saving copy of the {{chembox}} taken from revid 471321807 of page Astragalin for the Chem/Drugbox validation project (updated: 'ChEBI', 'ChEMBL', 'CASNo'). |
Latest revision as of 17:32, 11 March 2024 edit Citation bot (talk | contribs)Bots5,472,724 edits Add: bibcode, pages, issue, volume, journal, date, title, authors 1-1. | Use this bot. Report bugs. | Suggested by Marbletan | #UCB_webform |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 414761861 |
|
| verifiedrevid = 477368973 |
|
| Name = Astragalin |
|
| Name = Astragalin |
|
| ImageFile = Astragalin.svg |
|
| ImageFile = Astragalin.svg |
|
| ImageSize = 300px |
|
| ImageSize = 300px |
|
| ImageName = Astragalin structure |
|
| ImageName = Astragalin structure |
|
|
| IUPACName = 3-(β-<small>D</small>-Glucopyranosyloxy)-4′,5,7-trihydroxyflavone |
|
| IUPACName = 5,7-dihydroxy-2-(4-hydroxyphenyl)-3-[(2''S'',3''R'',4''S'',5''S'',6''R'')-3,4, |
|
|
5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
|
| SystematicName = 5,7-Dihydroxy-2-(4-hydroxyphenyl)-3-{oxy}-4''H''-1-benzopyran-4-one |
|
| OtherNames= Astragaline<br>asragalin<br>kaempferol-3-glucoside<br>Kaempferol 3-glucoside<br>Kaempferol 3-O-glucoside<br>Kaempferol-3-O-glucoside<br>Kaempferol-3-D-glucoside<br>Kaempferol-3-beta-monoglucoside |
|
| OtherNames= Astragaline<br>asragalin<br>kaempferol-3-glucoside<br>Kaempferol 3-glucoside<br>Kaempferol 3-O-glucoside<br>Kaempferol-3-O-glucoside<br>Kaempferol-3-D-glucoside<br>Kaempferol-3-beta-monoglucoside<br>Kaempferol 3-O-β-D-glucopyranoside |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo = <!-- blanked - oldvalue: 480-10-4 --> |
|
| CASNo = 480-10-4 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| ChEBI = 30200 |
|
|
|
| UNII = APM8UQ3Z9O |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
⚫ |
| ChEBI = 30200 |
|
| PubChem = 5282102 |
|
| PubChem = 5282102 |
|
| Beilstein=100568 |
|
| Beilstein=100568 |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL = 233930 |
|
| ChEMBL = 453290 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
|
| KEGG = C12249 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4445311 |
|
| ChemSpiderID = 4445311 |
|
| SMILES = O=C2C(\O1O((O)(O)1O)CO)=C(/Oc3cc(O)cc(O)c23)c4ccc(O)cc4 |
|
| SMILES = O=C2C(\O1O((O)(O)1O)CO)=C(/Oc3cc(O)cc(O)c23)c4ccc(O)cc4 |
|
| InChI = 1/C21H20O11/c22-7-13-15(26)17(28)18(29)21(31-13)32-20-16(27)14-11(25)5-10(24)6-12(14)30-19(20)8-1-3-9(23)4-2-8/h1-6,13,15,17-18,21-26,28-29H,7H2/t13-,15-,17+,18-,21+/m1/s1 |
|
| InChI = 1/C21H20O11/c22-7-13-15(26)17(28)18(29)21(31-13)32-20-16(27)14-11(25)5-10(24)6-12(14)30-19(20)8-1-3-9(23)4-2-8/h1-6,13,15,17-18,21-26,28-29H,7H2/t13-,15-,17+,18-,21+/m1/s1 |
|
| InChIKey = JPUKWEQWGBDDQB-QSOFNFLRBV |
|
| InChIKey = JPUKWEQWGBDDQB-QSOFNFLRBV |
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C21H20O11/c22-7-13-15(26)17(28)18(29)21(31-13)32-20-16(27)14-11(25)5-10(24)6-12(14)30-19(20)8-1-3-9(23)4-2-8/h1-6,13,15,17-18,21-26,28-29H,7H2/t13-,15-,17+,18-,21+/m1/s1 |
|
| StdInChI = 1S/C21H20O11/c22-7-13-15(26)17(28)18(29)21(31-13)32-20-16(27)14-11(25)5-10(24)6-12(14)30-19(20)8-1-3-9(23)4-2-8/h1-6,13,15,17-18,21-26,28-29H,7H2/t13-,15-,17+,18-,21+/m1/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = JPUKWEQWGBDDQB-QSOFNFLRSA-N |
|
| StdInChIKey = JPUKWEQWGBDDQB-QSOFNFLRSA-N |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=21 | H=20 | O=11 |
|
| Formula = C<sub>21</sub>H<sub>20</sub>O<sub>11</sub> |
|
|
| MolarMass = 448.37 g/mol |
|
| Density = 1.791 g/mL |
|
⚫ |
| MeltingPt = |
|
| ExactMass = 448.100561 u |
|
|
| Density = |
|
| BoilingPt = |
| ⚫ |
| MeltingPt = <!-- °C --> |
|
|
| BoilingPt = |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
'''Astragalin''' is a chemical compound. It can be isolated from '']'' (the American pokeweed) or in the ]ic extract of fronds of the fern '']''.<ref>{{cite journal | doi = 10.1016/S0031-9422(99)00326-X| title = Phenolic constituents of the fern Phegopteris connectilis| date = 1999| last1 = Adam| first1 = Klaus-Peter| journal = Phytochemistry| volume = 52| issue = 5| pages = 929–934| bibcode = 1999PChem..52..929A}}</ref> It is also ]. |
|
|
|
|
|
Astragalin is a 3-''O''-] of ]. |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
{{Flavonol}} |
|
|
|
|
|
] |
|
|
] |
|
|
|
|
|
{{Aromatic-stub}} |