Revision as of 02:40, 21 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'DrugBank_Ref', 'ChEBI_Ref') per [[WP:CHEMVALID|Chem/Drugbox valida← Previous edit |
Latest revision as of 18:46, 5 July 2024 edit undoWhywhenwhohow (talk | contribs)Autopatrolled, Extended confirmed users, Pending changes reviewers49,380 edits infobox, description, refs |
(23 intermediate revisions by 17 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Pharmaceutical drug}} |
|
{{Drugbox |
|
|
|
{{Use dmy dates|date=November 2019}} |
⚫ |
| verifiedrevid = 430685561 |
|
|
|
{{Infobox drug |
|
|
|
⚫ |
<!--Combo data--> |
|
|
| type = combo |
|
| type = combo |
|
⚫ |
| verifiedrevid = 451608217 |
|
|
|
|
⚫ |
<!-- Combo data--> |
|
| component1 = Aliskiren |
|
| component1 = Aliskiren |
|
| class1 = ] |
|
| class1 = ] |
Line 11: |
Line 13: |
|
| class3 = ] |
|
| class3 = ] |
|
|
|
|
|
<!--Clinical data--> |
|
<!-- Clinical data --> |
|
| tradename = |
|
| tradename = Amturnide |
|
| Drugs.com = {{drugs.com|CDI|aliskiren-amlodipine-hydrochlorothiazide}} |
|
| Drugs.com = {{drugs.com|cons|aliskiren-amlodipine-and-hydrochlorothiazide}} |
|
|
| MedlinePlus = |
|
| licence_EU = <!-- EMEA requires brand name --> |
|
|
| licence_US = Amturnide |
|
| DailyMedID = Amturnide |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
| pregnancy_AU_comment = |
|
| pregnancy_US = D |
|
|
|
| pregnancy_category= |
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
|
⚫ |
| routes_of_administration = ] |
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = Rx-only |
|
⚫ |
| routes_of_administration = ] |
|
|
|
|
⚫ |
<!--Identifiers--> |
|
|
| ATC_prefix = C09 |
|
| ATC_prefix = C09 |
|
| ATC_suffix = XA54 |
|
| ATC_suffix = XA54 |
|
|
| ATC_supplemental = |
⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
|
|
|
|
<!--Chemical data--> |
|
<!-- Legal status --> |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled --> |
|
|
| legal_AU_comment = |
|
|
| legal_BR = <!-- OTC, A1, A2, A3, B1, B2, C1, C2, C3, C4, C5, D1, D2, E, F --> |
|
|
| legal_BR_comment = |
|
⚫ |
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
| legal_CA_comment = |
|
|
| legal_DE = <!-- Anlage I, II, III or Unscheduled --> |
|
|
| legal_DE_comment = |
|
⚫ |
| legal_NZ = <!-- Class A, B, C --> |
|
|
| legal_NZ_comment = |
|
|
| legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM / Class A, B, C --> |
|
|
| legal_UK_comment = |
|
⚫ |
| legal_US = Rx-only |
|
|
| legal_US_comment = <ref name="Amturnide FDA label">{{cite web | title=Amturnide (aliskiren, amlodipine and hydrochlorothiazide) tablets, for oral use Initial U.S. Approval: 2010 | website=DailyMed | date=10 November 2016 | url=https://dailymed.nlm.nih.gov/dailymed/archives/fdaDrugInfo.cfm?archiveid=237747 | access-date=6 February 2022}}</ref> |
|
|
| legal_EU = |
|
|
| legal_EU_comment = |
|
|
| legal_UN = <!-- N I, II, III, IV / P I, II, III, IV --> |
|
|
| legal_UN_comment = |
|
|
| legal_status = <!-- For countries not listed above --> |
|
|
|
|
⚫ |
<!-- Identifiers --> |
|
|
| CAS_number = |
|
|
| CAS_supplemental = |
|
|
| PubChem = 56841821 |
|
|
| IUPHAR_ligand = |
|
|
| DrugBank = |
|
|
| ChemSpiderID = |
|
|
| UNII = |
|
⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D10291 |
|
|
| ChEBI = |
|
|
| ChEMBL = |
|
|
| NIAID_ChemDB = |
|
|
| PDB_ligand = |
|
|
| synonyms = |
|
|
|
|
|
<!-- Chemical and physical data --> |
|
|
| IUPAC_name = |
|
|
| C=57 | H=86 | Cl=2 | N=8 | O=15 | S=2 |
|
|
| SMILES = CCOC(=O)C1=C(NC(=C(C1C2=CC=CC=C2Cl)C(=O)OC)C)COCCN.CC(C)C(CC1=CC(=C(C=C1)OC)OCCCOC)CC(C(CC(C(C)C)C(=O)NCC(C)(C)C(=O)N)O)N.C1NC2=CC(=C(C=C2S(=O)(=O)N1)S(=O)(=O)N)Cl |
|
|
| StdInChI = 1S/C30H53N3O6.C20H25ClN2O5.C7H8ClN3O4S2/c1-19(2)22(14-21-10-11-26(38-8)27(15-21)39-13-9-12-37-7)16-24(31)25(34)17-23(20(3)4)28(35)33-18-30(5,6)29(32)36;1-4-28-20(25)18-15(11-27-10-9-22)23-12(2)16(19(24)26-3)17(18)13-7-5-6-8-14(13)21;8-4-1-5-7(2-6(4)16(9,12)13)17(14,15)11-3-10-5/h10-11,15,19-20,22-25,34H,9,12-14,16-18,31H2,1-8H3,(H2,32,36)(H,33,35);5-8,17,23H,4,9-11,22H2,1-3H3;1-2,10-11H,3H2,(H2,9,12,13)/t22-,23+,24-,25-;;/m0../s1 |
|
|
| StdInChI_comment = |
|
|
| StdInChIKey = YJDDFLDXUPNQTO-WMEHTASQSA-N |
|
|
| density = |
|
|
| density_notes = |
|
|
| melting_point = |
|
|
| melting_high = |
|
|
| melting_notes = |
|
|
| boiling_point = |
|
|
| boiling_notes = |
|
|
| solubility = |
|
|
| sol_units = |
|
|
| specific_rotation = |
|
}} |
|
}} |
|
|
|
|
|
|
'''Aliskiren/amlodipine/hydrochlorothiazide''', sold under the brand name '''Amturnide''', is a ] medication that is used to treat high blood pressure.<ref name="Amturnide FDA label" /><ref name="Neutel_2013">{{cite journal | vauthors = Neutel JM, Smith DH | title = Hypertension management: rationale for triple therapy based on mechanisms of action | journal = Cardiovascular Therapeutics | volume = 31 | issue = 5 | pages = 251–8 | date = October 2013 | pmid = 23121769 | doi = 10.1111/1755-5922.12015 }}</ref> It contains ], a ]; ], as the ], a ]; and ], a ].<ref name="Amturnide FDA label" /> It is taken ].<ref name="Amturnide FDA label" /> |
|
The ] combination ''']/]/]''' (], trade name '''Amturnide''') is an ] approved by the ] (FDA) on December 21, 2010.<ref>. ] (FDA).</ref> |
|
|
|
|
|
|
It was approved for medical use in the United States in December 2010.<ref name="Amturnide FDA label" /><ref>{{cite web | title=Amturnide (aliskiren, amlodipine and hydrochlorothiazide) tablets, for oral use Initial U.S. Approval: 2010 | website=DailyMed | url=https://dailymed.nlm.nih.gov/dailymed/archives/fdaDrugInfo.cfm?archiveid=237747 | access-date=5 July 2024}}</ref><ref>{{cite web | title=Drug Approval Package: Amturnide(amlodipine/aliskiren/hydrochlorothiazide) NDA #200045 | website=U.S. ] (FDA) | date=15 August 2011 | url=https://www.accessdata.fda.gov/drugsatfda_docs/nda/2010/200045s000_amturnide_toc.cfm | access-date=27 August 2020}} |
|
|
*{{lay source |template=cite web |title=Center for Drug Evaluation and Research: Application Number: 200045Orig1s000: Summary review |url=https://www.accessdata.fda.gov/drugsatfda_docs/nda/2010/200045Orig1s000SumR.pdf |website=Food and Drug Administration}}</ref> Amturnide was withdrawn by Novartis from the US market in 2017.<ref>{{cite web | title=Wyeth Pharmaceuticals Inc. et al.; Withdrawal of Approval of 121 New Drug Applications and 161 Abbreviated New Drug Applications | website=Federal Register | date=21 June 2017 | url=https://www.federalregister.gov/documents/2017/06/21/2017-12908/wyeth-pharmaceuticals-inc-et-al-withdrawal-of-approval-of-121-new-drug-applications-and-161 | access-date=6 February 2022}}</ref> |
|
|
|
|
|
== References == |
|
== References == |
Line 38: |
Line 91: |
|
|
|
|
|
==External links== |
|
==External links== |
|
|
* {{cite web | title=FDA Drug Safety Communication: New Warning and Contraindication for blood pressure medicines containing aliskiren (Tekturna) | website=U.S. ] (FDA) | date=29 June 2021 | url=https://www.fda.gov/drugs/drug-safety-and-availability/fda-drug-safety-communication-new-warning-and-contraindication-blood-pressure-medicines-containing }} |
|
* |
|
|
|
|
|
|
{{Agents acting on the renin-angiotensin system}} |
|
{{Agents acting on the renin-angiotensin system}} |
|
{{Calcium channel blockers}} |
|
{{Calcium channel blockers}} |
|
{{Diuretics}} |
|
{{Diuretics}} |
|
|
{{Portal bar | Medicine}} |
|
|
|
|
|
{{DEFAULTSORT:Aliskiren Amlodipine Hydrochlorothiazide}} |
|
⚫ |
] |
|
|
] |
|
|
] |
|
|
|
|
⚫ |
] |
|
|
|
|
|
|
{{cardiovascular-drug-stub}} |
|
{{cardiovascular-drug-stub}} |