| Revision as of 16:31, 28 November 2010 editBeetstra (talk | contribs)Edit filter managers, Administrators172,294 edits Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: InChI1->InChI StdInChI StdInChIKey.← Previous edit |
Latest revision as of 22:52, 27 April 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,896 edits fix mistake |
| (26 intermediate revisions by 20 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| verifiedrevid = 399341889 |
|
|Name=7-α-Hydroxycholesterol |
|
| Name=7α-Hydroxycholesterol |
|
|ImageFile=7-alpha-hydroxycholesterol.svg |
|
| ImageFile=7-alpha-hydroxycholesterol.svg |
|
|ImageSize= |
|
| ImageSize=250px |
| ⚫ |
|IUPACName=(3''S'',7''S'',8''S'',9''S'',10''R'',13''R'',14''S'',17''R'')-10,13-dimethyl-17--2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1''H''-cyclopentaphenanthrene-3,7-diol |
|
|
|
| IUPACName=Cholest-5-ene-3β,7α-diol |
| ⚫ |
|OtherNames= |
|
|
⚫ |
| SystematicName=(1''R'',3a''S'',3b''S'',4''S'',7''S'',9a''R'',9b''S'',11a''R'')-9a,11a-Dimethyl-1--2,3,3a,3b,4,6,7,8,9,9a,9b,10,11,11a-tetradecahydro-1''H''-cyclopentaphenanthrene-4,7-diol |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
⚫ |
| OtherNames= |
| ⚫ |
| ChemSpiderID = 96891 |
|
|
⚫ |
|Section1={{Chembox Identifiers |
|
|
| IUPHAR_ligand = 4351 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 96891 |
|
|
| ChEBI = 17500 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 95D0I22I0V |
|
| InChI = 1/C27H46O2/c1-17(2)7-6-8-18(3)21-9-10-22-25-23(12-14-27(21,22)5)26(4)13-11-20(28)15-19(26)16-24(25)29/h16-18,20-25,28-29H,6-15H2,1-5H3/t18-,20+,21-,22+,23+,24-,25+,26+,27-/m1/s1 |
|
| InChI = 1/C27H46O2/c1-17(2)7-6-8-18(3)21-9-10-22-25-23(12-14-27(21,22)5)26(4)13-11-20(28)15-19(26)16-24(25)29/h16-18,20-25,28-29H,6-15H2,1-5H3/t18-,20+,21-,22+,23+,24-,25+,26+,27-/m1/s1 |
|
| InChIKey = OYXZMSRRJOYLLO-RVOWOUOIBF |
|
| InChIKey = OYXZMSRRJOYLLO-RVOWOUOIBF |
|
| SMILES1 = O4C/C3=C/(O)1(CC2(1CC2(C)CCCC(C)C)C)3(C)CC4 |
|
| SMILES1 = O4C/C3=C/(O)1(CC2(1CC2(C)CCCC(C)C)C)3(C)CC4 |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C27H46O2/c1-17(2)7-6-8-18(3)21-9-10-22-25-23(12-14-27(21,22)5)26(4)13-11-20(28)15-19(26)16-24(25)29/h16-18,20-25,28-29H,6-15H2,1-5H3/t18-,20+,21-,22+,23+,24-,25+,26+,27-/m1/s1 |
|
| StdInChI = 1S/C27H46O2/c1-17(2)7-6-8-18(3)21-9-10-22-25-23(12-14-27(21,22)5)26(4)13-11-20(28)15-19(26)16-24(25)29/h16-18,20-25,28-29H,6-15H2,1-5H3/t18-,20+,21-,22+,23+,24-,25+,26+,27-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = OYXZMSRRJOYLLO-RVOWOUOISA-N |
|
| StdInChIKey = OYXZMSRRJOYLLO-RVOWOUOISA-N |
|
| CASNo=566-26-7 |
|
| CASNo=566-26-7 |
|
| PubChem=107722 |
|
| PubChem=107722 |
|
| SMILES=CC(C)CCC(C)1CC21(CC32(C=C43(CC(C4)O)C)O)C |
|
| SMILES=CC(C)CCC(C)1CC21(CC32(C=C43(CC(C4)O)C)O)C |
|
| MeSHName=7+alpha-hydroxycholesterol |
|
| MeSHName=7+alpha-hydroxycholesterol |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>27</sub>H<sub>46</sub>O<sub>2</sub> |
|
| Formula=C<sub>27</sub>H<sub>46</sub>O<sub>2</sub> |
|
| MolarMass=402.653 g/mol |
|
| MolarMass=402.653 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''7-α-Hydroxycholesterol''' is a precursor of ]s, created by ]. It is the ]. |
|
'''7α-Hydroxycholesterol''' is a ] of ]s, created by ] (CYP7A1). Its formation is the ] in bile acid synthesis.<ref name="pmid31984784">{{cite journal | vauthors = Chiang JY, Ferrell JM | title = Bile acid receptors FXR and TGR5 signaling in fatty liver diseases and therapy | journal = American Journal of Physiology. Gastrointestinal and Liver Physiology | volume = 318 | issue = 3 | pages = G554–G573 | date = March 2020 | pmid = 31984784 | pmc = 7099488 | doi = 10.1152/ajpgi.00223.2019 | url = }}</ref> |
|
|
|
|
|
|
==References== |
| ⚫ |
{{DEFAULTSORT:Hydroxycholesterol, 7-alpha-}} |
|
|
|
{{Reflist|2}} |
| ⚫ |
] |
|
|
|
|
|
|
|
|
|
|
|
{{Cholesterol and steroid intermediates}} |
| ⚫ |
{{biochem-stub}} |
|
|
|
{{Endogenous steroids}} |
|
|
|
|
|
⚫ |
{{DEFAULTSORT:Hydroxycholesterol, 7alpha-}} |
|
] |
|
|
|
|
|
⚫ |
] |
|
|
|
|
|
|
|
⚫ |
{{steroid-stub}} |