| Revision as of 18:39, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,284 edits Saving copy of the {{chembox}} taken from revid 454998691 of page 6-Phosphogluconolactone for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 18:07, 29 August 2024 edit DinosaursLoveExistence (talk | contribs)Extended confirmed users16,529 editsm →See also: Category |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 443357776 |
|
| verifiedrevid = 477226250 |
|
| ImageFile = 6-phosphogluconolactone.svg |
|
| ImageFile = 6-phosphogluconolactone.svg |
|
| ImageSize = |
|
| ImageSize = |
|
|
| ImageAlt = Skeletal formula of 6-phosphogluconolactone |
|
| IUPACName = |
|
|
|
| ImageFile1 = 6-Phosphogluconolactone-anion-3D-spacefill.png |
|
| OtherNames = |
|
|
|
| ImageSize1 = 180 |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
|
| ImageAlt1 = Space-filling model of the 6-phosphogluconolactone anion |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| IUPACName = <small>D</small>-Glucono-1,5-lactone 6-(dihydrogen phosphate) |
|
|
| SystematicName = methyl dihydrogen phosphate |
|
|
| OtherNames =6-phospho-D-glucono-1,5-lactone <br> 6-phospho-D-glucono-δ-lactone <br> D-6-phosphoglucono-1,5-lactone <br> D-6-phosphoglucono-δ-lactone <br> D-glucono-1,5-lactone 6-phosphate <br> D-glucono-δ-lactone 6-phosphate |
|
⚫ |
|Section1={{Chembox Identifiers |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 388559 |
|
| ChemSpiderID = 388559 |
|
| InChI = 1/C6H11O9P/c7-3-2(1-14-16(11,12)13)15-6(10)5(9)4(3)8/h2-5,7-9H,1H2,(H2,11,12,13)/t2-,3-,4+,5-/m1/s1 |
|
| InChI = 1/C6H11O9P/c7-3-2(1-14-16(11,12)13)15-6(10)5(9)4(3)8/h2-5,7-9H,1H2,(H2,11,12,13)/t2-,3-,4+,5-/m1/s1 |
| Line 15: |
Line 20: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = IJOJIVNDFQSGAB-SQOUGZDYSA-N |
|
| StdInChIKey = IJOJIVNDFQSGAB-SQOUGZDYSA-N |
|
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo = <!-- blanked - oldvalue: 2641-81-8 --> |
|
|
| PubChem = 600 |
|
| CASNo = 2641-81-8 |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| PubChem = 600 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 16938 |
|
| ChEBI = 16938 |
|
| SMILES = O=C1O(COP(=O)(O)O)(O)(O)1O |
|
| SMILES = O=C1O(COP(=O)(O)O)(O)(O)1O |
|
| MeSHName = 6-phosphogluconolactone |
|
| MeSHName = 6-phosphogluconolactone |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>6</sub>H<sub>11</sub>O<sub>9</sub>P |
|
| Formula = C<sub>6</sub>H<sub>11</sub>O<sub>9</sub>P |
|
| MolarMass = 258.12 g/mol |
|
| MolarMass = 258.12 g/mol |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| Solubility = |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| AutoignitionPt = |
|
| Autoignition = |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''6-Phosphogluconolactone''' is an intermediate in the ] (PPP). |
|
|
|
|
|
In the PPP pathway, it is produced from ] by ]. It is then converted to ] by ]. |
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
{{Pentose phosphate pathway intermediates}} |
|
|
|
|
|
{{DEFAULTSORT:Phosphogluconolactone, 6-}} |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{biochem-stub}} |