Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and 3-Methylhexane: Difference between pages - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
(Difference between pages)
Page 1
Page 2
Content deleted Content addedVisualWikitext
Revision as of 17:58, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,294 edits Saving copy of the {{chembox}} taken from revid 471016131 of page 3-Methylhexane for the Chem/Drugbox validation project (updated: '').  Latest revision as of 10:47, 28 August 2022 edit Jérôme (talk | contribs)Extended confirmed users3,612 edits capitalization 
Line 1: Line 1:
{{Chembox
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
| Verifiedfields = changed
{{chembox
| Watchedfields = changed | Watchedfields = changed
| verifiedrevid = 413267760 | verifiedrevid = 477219751
| ImageFile = 3-methylhexane.png | ImageFile = 3-Methylhexane skeletal.svg
| ImageFile_Ref = {{chemboximage|correct|??}}
| ImageSize = 180px
| ImageSize = 160
| ImageName = Skeletal formula
| ImageName = Skeletal formula of 3-methylhexane
| ImageFile1 = 3-Methylhexane-3D-balls.png
| ImageFile1 = 3Methylhexane.png
| ImageName1 = Ball-and-stick model
| ImageFile1_Ref = {{chemboximage|correct|??}}
|IUPACName=3-Methylhexane
| ImageSize1 = 150
|OtherNames=
| ImageName1 = Ball-and-Stick model of 3-methylhexane
| PIN = 3-Methylhexane<ref>{{Cite web|title=3-METHYLHEXANE – Compound Summary|url=https://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11507&loc=ec_rcs|work=PubChem Compound|publisher=Nation Center for Biotechnology Information|access-date=6 March 2012|location=USA|date=26 March 2005|at=Identification and Related Records}}</ref>
|Section1={{Chembox Identifiers |Section1={{Chembox Identifiers
| CASNo = 589-34-4
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo1 = 78918-91-9
| CASNo2 = 6131-24-4
| index1_label = (''R'')
| index2_label = (''S'')
| PubChem = 11507
| PubChem1 = 13800357
| PubChem2 = 638046
| ChEBI = 143848
| ChemSpiderID = 11023 | ChemSpiderID = 11023
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| InChI = 1/C7H16/c1-4-6-7(3)5-2/h7H,4-6H2,1-3H3
| ChemSpiderID1 = 21428376
| InChIKey = VLJXXKKOSFGPHI-UHFFFAOYAV
| ChemSpiderID2 = 553610
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChemSpiderID2_Ref = {{chemspidercite|correct|chemspider}}
| EINECS = 209-643-3
| UNNumber = 1206
| ChEMBL = 31377 | ChEMBL = 31377
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| Beilstein = 1718739
| SMILES = CCCC(C)CC
| SMILES1 = CCC(C)CC
| SMILES2 = CCC(C)CC
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 1J3ZK6L6VY
| UNII1 = 597F91020C
| UNII2 = 66M56682SH
| StdInChI = 1S/C7H16/c1-4-6-7(3)5-2/h7H,4-6H2,1-3H3 | StdInChI = 1S/C7H16/c1-4-6-7(3)5-2/h7H,4-6H2,1-3H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = VLJXXKKOSFGPHI-UHFFFAOYSA-N | StdInChIKey = VLJXXKKOSFGPHI-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|CAS}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| InChI1=1S/C7H16/c1-4-6-7(3)5-2/h7H,4-6H2,1-3H3/t7-/m1/s1
| CASNo=589-34-4
| InChIKey1 = VLJXXKKOSFGPHI-SSDOTTSWSA-N
| PubChem=11507
| InChI2=1S/C7H16/c1-4-6-7(3)5-2/h7H,4-6H2,1-3H3/t7-/m0/s1
| SMILES = CCCC(C)CC
| InChIKey2 = VLJXXKKOSFGPHI-ZETCQYMHSA-N
}} }}
|Section2={{Chembox Properties |Section2={{Chembox Properties
| C=7|H=16 | C=7 | H=16
| Appearance= | Appearance = Colorless liquid
| Odor = Odorless
| Density=
| Density = 686 mg mL<sup>−1</sup>
| MeltingPt=
| MeltingPtK = 153.75
| BoilingPt=
| BoilingPtK = 364.7 to 365.3
| Solubility=
| LogP = 4.118
}}
| VaporPressure = 14.7 kPa (at 37.7 °C)
|Section3={{Chembox Hazards
| HenryConstant = 3.2 nmol Pa<sup>−1</sup> kg<sup>−1</sup>
| MainHazards=
| RefractIndex = 1.388–1.389
| FlashPt=
}}
| Autoignition=
|Section3={{Chembox Thermochemistry
}}
| DeltaHf = −228.7–−226.1 kJ mol<sup>−1</sup>
| DeltaHc = −4.8151–−4.8127 MJ mol<sup>−1</sup>
| Entropy = 309.6 J K<sup>−1</sup> mol<sup>−1</sup>
| HeatCapacity = 216.7 J K<sup>−1</sup> mol<sup>−1</sup> (at −9.0 °C)
}}
|Section4={{Chembox Hazards
| GHSPictograms = {{GHS02}}{{GHS07}}{{GHS08}}{{GHS09}}
| GHSSignalWord = Danger
| HPhrases = {{H-phrases|225|304|315|336|411}}
| PPhrases = {{P-phrases|210|233|240|241|242|243|261|264|271|273|280|301+310|302+352|303+361+353|304+340|312|321|331|332+313|362|370+378|391|403+233|403+235|405|501}}
| FlashPtC = -1.0
| AutoignitionPtC = 280
| ExploLimits = 1–7%
}}
|Section5={{Chembox Related
| OtherFunction_label = alkanes
| OtherFunction = {{Unbulleted list|]|]|]|]|]|]}}
| OtherCompounds = {{Unbulleted list|]|]|]|]|]}}
}}
}} }}
'''3-Methylhexane''' is a branched ] with two enantiomers.<ref>Tro, Nivaldo J. Chemistry A Molecular Approach. Upper Saddle River, NJ: Pearson Prentice Hall, 2008</ref> It is one of the ] of ].

The molecule is ], and is one of the two isomers of heptane to have this property, the other being its structural isomer ]. The enantiomers are (''R'')-3-methylhexane<ref>{{Cite web|url=https://pubchem.ncbi.nlm.nih.gov/compound/13800357|title = (-)-3-Methylhexane}}</ref> and (''S'')-3-methylhexane.<ref>{{Cite web|url=https://pubchem.ncbi.nlm.nih.gov/compound/638046|title=(+)-3-Methylhexane}}</ref>

==References==
{{Reflist}}

{{DEFAULTSORT:Methylhexane, 3-}}
]
Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and 3-Methylhexane: Difference between pages Add topic