| Revision as of 05:36, 17 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,294 edits Saving copy of the {{chembox}} taken from revid 456683167 of page Alpha-Tocotrienol for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 02:13, 12 January 2025 edit Arthurfragoso (talk | contribs)Extended confirmed users, Template editors4,951 edits dark mode fix |
| Line 1: |
Line 1: |
|
|
{{lowercasetitle}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 456681709 |
|
| verifiedrevid = 477319758 |
|
|Reference=<ref> at ]</ref> |
|
| Reference=<ref> at ]</ref> |
|
|Name=α-Tocotrienol |
|
| Name=α-Tocotrienol |
|
|ImageFile=Alpha-tocotrienol-bkchem.png |
|
| ImageFile=Alpha-tocotrienol-bkchem.png |
|
|
| ImageClass = skin-invert-image |
|
|ImageSize=300 |
|
|
|ImageFileL2=Alpha-tocotrienol_spacefill.png |
|
| ImageFileL2=Alpha-tocotrienol_spacefill.png |
|
⚫ |
| ImageFileR2=Alpha-tocotrienol-bns.png |
|
|ImageSizeL2=150 |
|
|
⚫ |
| PIN=(2''R'')-2,5,7,8-Tetramethyl-2--3,4-dihydro-2''H''-1-benzopyran-6-ol |
| ⚫ |
|ImageFileR2=Alpha-tocotrienol-bns.png |
|
|
⚫ |
| OtherNames= |
|
|ImageSizeR2=150 |
|
| ⚫ |
|IUPACName=(2''R'')-2,5,7,8-tetramethyl-2--3,4-dihydrochromen-6-ol |
|
| ⚫ |
|OtherNames= |
|
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| Line 19: |
Line 17: |
|
| InChIKey = RZFHLOLGZPDCHJ-XZXLULOTSA-N |
|
| InChIKey = RZFHLOLGZPDCHJ-XZXLULOTSA-N |
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo = <!-- blanked - oldvalue: 58864-81-6 --> |
|
| CASNo=58864-81-6 |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 33270 |
|
| ChEBI = 33270 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| Line 29: |
Line 27: |
|
| ChEMBL = 120276 |
|
| ChEMBL = 120276 |
|
| PubChem=5282347 |
|
| PubChem=5282347 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = B6LXL1832Y |
|
| UNII = B6LXL1832Y |
|
| SMILES = CC1=C(C(=C2CC(OC2=C1C)(C)CC/C=C(\C)/CC/C=C(\C)/CCC=C(C)C)C)O |
|
| SMILES = CC1=C(C(=C2CC(OC2=C1C)(C)CC/C=C(\C)/CC/C=C(\C)/CCC=C(C)C)C)O |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>29</sub>H<sub>44</sub>O<sub>2</sub> |
|
| Formula=C<sub>29</sub>H<sub>44</sub>O<sub>2</sub> |
|
| MolarMass=424.66 g/mol |
|
| MolarMass=424.66 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''α-Tocotrienol''' is a form of ] and one of the ]s that is considered ]. |
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
{{DEFAULTSORT:Tocotrienol, alpha-}} |
|
|
{{organic-compound-stub}} |
|
|
{{Vitamin}} |
|
|
|
|
|
] |